EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:10049 - XTP
| Formula | C10H15N4O15P3 |
| Net Charge | 0 |
| Average Mass | 524.165 |
| Monoisotopic Mass | 523.97468 |
| SMILES | O=c1nc(=O)c2ncn([C@@H]3O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C10H15N4O15P3/c15-5-3(1-26-31(22,23)29-32(24,25)28-30(19,20)21)27-9(6(5)16)14-2-11-4-7(14)12-10(18)13-8(4)17/h2-3,5-6,9,15-16H,1H2,(H,22,23)(H,24,25)(H2,19,20,21)(H2,12,13,17,18)/t3-,5-,6-,9-/m1/s1 |
| InChIKey | CAEFEWVYEZABLA-UUOKFMHZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| XTP (CHEBI:10049) has role Escherichia coli metabolite (CHEBI:76971) |
| XTP (CHEBI:10049) has role mouse metabolite (CHEBI:75771) |
| XTP (CHEBI:10049) is a purine ribonucleoside 5'-triphosphate (CHEBI:37045) |
| XTP (CHEBI:10049) is a xanthosine 5'-phosphate (CHEBI:53012) |
| XTP (CHEBI:10049) is conjugate acid of XTP(3−) (CHEBI:59885) |
| Incoming Relation(s) |
| ethyl-XTP (CHEBI:62906) has functional parent XTP (CHEBI:10049) |
| XTP(3−) (CHEBI:59885) is conjugate base of XTP (CHEBI:10049) |
| IUPAC Name |
|---|
| xanthosine 5'-(tetrahydrogen triphosphate) |
| Synonyms | Source |
|---|---|
| XTP | KEGG COMPOUND |
| Xanthosine triphosphate | ChemIDplus |
| Xanthosine 5'-triphosphate | ChemIDplus |
| O5'-(tetrahydroxytriphosphoryl)xanthosine | ChEBI |
| triphopsphoric acid 1-xanthosin-5'-yl ester | ChEBI |
| Xanthosine 5'-triphosphate | KEGG COMPOUND |