EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H28N2O2.HCl |
| Net Charge | 0 |
| Average Mass | 388.939 |
| Monoisotopic Mass | 388.19176 |
| SMILES | COc1ccc(C(=O)Nc2ccccc2CCC2CCCCN2C)cc1.Cl |
| InChI | InChI=1S/C22H28N2O2.ClH/c1-24-16-6-5-8-19(24)13-10-17-7-3-4-9-21(17)23-22(25)18-11-14-20(26-2)15-12-18;/h3-4,7,9,11-12,14-15,19H,5-6,8,10,13,16H2,1-2H3,(H,23,25);1H |
| InChIKey | OJIIZIWOLTYOBS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| encainide hydrochloride (CHEBI:59880) has part encainide (CHEBI:4788) |
| encainide hydrochloride (CHEBI:59880) has role anti-arrhythmia drug (CHEBI:38070) |
| encainide hydrochloride (CHEBI:59880) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 2-(2-{2-[(4-methoxybenzoyl)amino]phenyl}ethyl)-1-methylpiperidinium chloride |
| Synonyms | Source |
|---|---|
| (±)-2'-(2-(1-methyl-2-piperidyl)ethyl)-p-anisanilide monohydrochloride | ChemIDplus |
| 4-methoxy-2'-(2-(1-methyl-2-piperidyl)ethyl)benzanilide hydrochloride | ChemIDplus |
| 4-methoxy-N-{2-[2-(1-methylpiperidin-2-yl)ethyl]phenyl}benzamide hydrochloride | IUPAC |
| encainide HCl | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6360008 | Beilstein |
| CAS:66794-74-9 | KEGG DRUG |
| CAS:66794-74-9 | ChemIDplus |