EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H28N2O2 |
| Net Charge | 0 |
| Average Mass | 352.478 |
| Monoisotopic Mass | 352.21508 |
| SMILES | COc1ccc(C(=O)Nc2ccccc2CCC2CCCCN2C)cc1 |
| InChI | InChI=1S/C22H28N2O2/c1-24-16-6-5-8-19(24)13-10-17-7-3-4-9-21(17)23-22(25)18-11-14-20(26-2)15-12-18/h3-4,7,9,11-12,14-15,19H,5-6,8,10,13,16H2,1-2H3,(H,23,25) |
| InChIKey | PJWPNDMDCLXCOM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | sodium channel blocker An agent that inhibits sodium influx through cell membranes. |
| Application: | anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| encainide (CHEBI:4788) has role anti-arrhythmia drug (CHEBI:38070) |
| encainide (CHEBI:4788) has role sodium channel blocker (CHEBI:38633) |
| encainide (CHEBI:4788) is a benzamides (CHEBI:22702) |
| encainide (CHEBI:4788) is a piperidines (CHEBI:26151) |
| Incoming Relation(s) |
| encainide hydrochloride (CHEBI:59880) has part encainide (CHEBI:4788) |
| IUPAC Name |
|---|
| 4-methoxy-N-{2-[2-(1-methylpiperidin-2-yl)ethyl]phenyl}benzamide |
| INNs | Source |
|---|---|
| encainide | ChemIDplus |
| encainida | ChemIDplus |
| encainide | ChemIDplus |
| encainidum | ChemIDplus |
| Synonyms | Source |
|---|---|
| Encainide | KEGG COMPOUND |
| 4-Methoxy-N-{2-[2-(1-methyl-piperidin-2-yl)-ethyl]-phenyl}-benzamide | ChEMBL |
| (±)-2'-[2-(1-methyl-2-piperidyl)ethyl]-p-anisanilide | ChEBI |
| (±)-4-methoxy-N-(2-(2-(1-methyl-2-piperidinyl)ethyl)phenyl)benzamide | ChemIDplus |
| 4-methoxy-2'-[2-(1-methyl-2-piperidyl)ethyl]benzanilide | ChEBI |