EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H26N4O.2C4H4O4 |
| Net Charge | 0 |
| Average Mass | 534.566 |
| Monoisotopic Mass | 534.23258 |
| SMILES | CCOCCn1c(N2CCCN(C)CC2)nc2ccccc21.O=C(O)/C=C\C(=O)O.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C17H26N4O.2C4H4O4/c1-3-22-14-13-21-16-8-5-4-7-15(16)18-17(21)20-10-6-9-19(2)11-12-20;2*5-3(6)1-2-4(7)8/h4-5,7-8H,3,6,9-14H2,1-2H3;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1- |
| InChIKey | FWLKKPKZQYVAFR-SPIKMXEPSA-N |
| Roles Classification |
|---|
| Biological Role: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| Applications: | anti-allergic agent A drug used to treat allergic reactions. antipruritic drug A drug, usually applied topically, that relieves pruritus (itching). H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| emedastine difumarate (CHEBI:59865) has part emedastine (CHEBI:4779) |
| emedastine difumarate (CHEBI:59865) has role anti-allergic agent (CHEBI:50857) |
| emedastine difumarate (CHEBI:59865) has role antipruritic drug (CHEBI:59683) |
| emedastine difumarate (CHEBI:59865) has role H1-receptor antagonist (CHEBI:37955) |
| emedastine difumarate (CHEBI:59865) is a fumarate salt (CHEBI:50921) |
| IUPAC Name |
|---|
| 1-(2-ethoxyethyl)-2-(4-methyl-1,4-diazepan-1-yl)-1H-benzimidazole bis[(2Z)-but-2-enedioate] |
| INN | Source |
|---|---|
| emedastine fumarate | ChEBI |
| Synonyms | Source |
|---|---|
| 1-(2-ethoxyethyl)-2-(4-methyl-1-homopiperazinyl)benzimidazole difumarate | ChemIDplus |
| 1-(2-ethoxyethyl)-2-(4-methylhexahydro-1H-1,4-diazepin-1-yl)benzimidazole fumarate (1:2) | ChemIDplus |
| 1-(2-ethoxyethyl)-2-(hexahydro-4-methyl-1H-1,4-diazepin-1-yl)benzimidazole fumarate (1:2) | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6049907 | Beilstein |
| CAS:87233-62-3 | ChemIDplus |