EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H26N4O |
| Net Charge | 0 |
| Average Mass | 302.422 |
| Monoisotopic Mass | 302.21066 |
| SMILES | CCOCCn1c(N2CCCN(C)CC2)nc2ccccc21 |
| InChI | InChI=1S/C17H26N4O/c1-3-22-14-13-21-16-8-5-4-7-15(16)18-17(21)20-10-6-9-19(2)11-12-20/h4-5,7-8H,3,6,9-14H2,1-2H3 |
| InChIKey | KBUZBQVCBVDWKX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| Applications: | antipruritic drug A drug, usually applied topically, that relieves pruritus (itching). H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. anti-allergic agent A drug used to treat allergic reactions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| emedastine (CHEBI:4779) has role anti-allergic agent (CHEBI:50857) |
| emedastine (CHEBI:4779) has role antipruritic drug (CHEBI:59683) |
| emedastine (CHEBI:4779) has role H1-receptor antagonist (CHEBI:37955) |
| emedastine (CHEBI:4779) is a benzimidazoles (CHEBI:22715) |
| Incoming Relation(s) |
| emedastine difumarate (CHEBI:59865) has part emedastine (CHEBI:4779) |
| IUPAC Name |
|---|
| 1-(2-ethoxyethyl)-2-(4-methyl-1,4-diazepan-1-yl)-1H-benzimidazole |
| INNs | Source |
|---|---|
| emedastina | ChemIDplus |
| emedastine | ChemIDplus |
| emedastinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-(2-Ethoxy-ethyl)-2-(4-methyl-[1,4]diazepan-1-yl)-1H-benzoimidazole | ChEMBL |
| 1-[2-(ethoxy)ethyl]-2-(4-methyl-1-homopiperazinyl)benzimidazole | ChEBI |
| 1-(2-ethoxyethyl)-2-(hexahydro-4-methyl-1H-1,4-diazepin-1-yl)benzimidazole | ChemIDplus |
| Emedastine | KEGG COMPOUND |
| EMEDASTINE | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6068161 | Beilstein |
| CAS:87233-61-2 | KEGG COMPOUND |
| CAS:87233-61-2 | ChemIDplus |