EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:59849 - ecothiopate iodide
| Formula | C9H23NO3PS.I |
| Net Charge | 0 |
| Average Mass | 383.232 |
| Monoisotopic Mass | 383.01810 |
| SMILES | CCOP(=O)(OCC)SCC[N+](C)(C)C.[I-] |
| InChI | InChI=1S/C9H23NO3PS.HI/c1-6-12-14(11,13-7-2)15-9-8-10(3,4)5;/h6-9H2,1-5H3;1H/q+1;/p-1 |
| InChIKey | OVXQHPWHMXOFRD-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Roles: | miotic An agent causing contraction of the pupil of the eye. Because the size of the pupil is under the antagonistic control of the sympathetic and parasympathetic systems, drugs affecting either system can cause miosis. Drugs that mimic or potentiate the parasympathetic input to the circular constrictor muscle and drugs that inhibit sympathetic input to the radial dilator muscle tend to contract the pupils. EC 3.1.1.8 (cholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of cholinesterase (EC 3.1.1.8). |
| Applications: | miotic An agent causing contraction of the pupil of the eye. Because the size of the pupil is under the antagonistic control of the sympathetic and parasympathetic systems, drugs affecting either system can cause miosis. Drugs that mimic or potentiate the parasympathetic input to the circular constrictor muscle and drugs that inhibit sympathetic input to the radial dilator muscle tend to contract the pupils. antiglaucoma drug Any drug which can be used to prevent or alleviate glaucoma, a disease in which the optic nerve is damaged, resulting in progressive, irreversible loss of vision. It is often, though not always, associated with increased pressure of the fluid in the eye. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ecothiopate iodide (CHEBI:59849) has part ecothiopate (CHEBI:4753) |
| ecothiopate iodide (CHEBI:59849) has role antiglaucoma drug (CHEBI:39456) |
| ecothiopate iodide (CHEBI:59849) has role EC 3.1.1.8 (cholinesterase) inhibitor (CHEBI:37733) |
| ecothiopate iodide (CHEBI:59849) has role miotic (CHEBI:51068) |
| ecothiopate iodide (CHEBI:59849) is a iodide salt (CHEBI:24858) |
| ecothiopate iodide (CHEBI:59849) is a quaternary ammonium salt (CHEBI:35273) |
| IUPAC Name |
|---|
| 2-[(diethoxyphosphoryl)sulfanyl]-N,N,N-trimethylethanaminium iodide |
| INNs | Source |
|---|---|
| ecothiopate iodide | KEGG DRUG |
| ioduro de ecotiopato | ChemIDplus |
| ecothiopati iodidum | ChemIDplus |
| iodure d'ecothiopate | ChemIDplus |
| Synonyms | Source |
|---|---|
| diethoxyphosphoryl-thiocholine iodide | ChemIDplus |
| N-(2-(diethoxyphosphinylthio)ethyl)trimethylammonium iodide | ChemIDplus |
| ecothiophate iodide | ChemIDplus |
| S-(2-(N,N,N-trimethylammonio)ethyl) O,O-diethylphosphorothiolate iodide | ChemIDplus |
| S-(2-dimethylaminoethyl)-O,O-diethylphosphorothioate methiodide | ChemIDplus |
| O,O-diethyl S-2-trimethylammonium ethylphosphonothiolate iodide | ChemIDplus |