EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:4753 - ecothiopate
| Formula | C9H23NO3PS |
| Net Charge | +1 |
| Average Mass | 256.328 |
| Monoisotopic Mass | 256.11308 |
| SMILES | CCOP(=O)(OCC)SCC[N+](C)(C)C |
| InChI | InChI=1S/C9H23NO3PS/c1-6-12-14(11,13-7-2)15-9-8-10(3,4)5/h6-9H2,1-5H3/q+1 |
| InChIKey | BJOLKYGKSZKIGU-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 3.1.1.8 (cholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of cholinesterase (EC 3.1.1.8). miotic An agent causing contraction of the pupil of the eye. Because the size of the pupil is under the antagonistic control of the sympathetic and parasympathetic systems, drugs affecting either system can cause miosis. Drugs that mimic or potentiate the parasympathetic input to the circular constrictor muscle and drugs that inhibit sympathetic input to the radial dilator muscle tend to contract the pupils. |
| Applications: | antiglaucoma drug Any drug which can be used to prevent or alleviate glaucoma, a disease in which the optic nerve is damaged, resulting in progressive, irreversible loss of vision. It is often, though not always, associated with increased pressure of the fluid in the eye. miotic An agent causing contraction of the pupil of the eye. Because the size of the pupil is under the antagonistic control of the sympathetic and parasympathetic systems, drugs affecting either system can cause miosis. Drugs that mimic or potentiate the parasympathetic input to the circular constrictor muscle and drugs that inhibit sympathetic input to the radial dilator muscle tend to contract the pupils. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ecothiopate (CHEBI:4753) has role antiglaucoma drug (CHEBI:39456) |
| ecothiopate (CHEBI:4753) has role EC 3.1.1.8 (cholinesterase) inhibitor (CHEBI:37733) |
| ecothiopate (CHEBI:4753) has role miotic (CHEBI:51068) |
| ecothiopate (CHEBI:4753) is a organic thiophosphate (CHEBI:37512) |
| ecothiopate (CHEBI:4753) is a phosphocholines (CHEBI:36700) |
| ecothiopate (CHEBI:4753) is a quaternary ammonium ion (CHEBI:35267) |
| Incoming Relation(s) |
| ecothiopate iodide (CHEBI:59849) has part ecothiopate (CHEBI:4753) |
| IUPAC Name |
|---|
| 2-[(diethoxyphosphoryl)sulfanyl]-N,N,N-trimethylethanaminium |
| INNs | Source |
|---|---|
| ecothiopate | ChEBI |
| ecothiopatum | ChEBI |
| Synonyms | Source |
|---|---|
| (2-diethoxyphosphinylthioethyl)trimethylammonium | ChEBI |
| echothiophate | ChEMBL |
| Echothiophate | KEGG COMPOUND |
| Echothiophate cation | ChEMBL |
| Echothiophate ion | ChEMBL |
| Ecothiopate cation | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 982 | DrugCentral |
| C06975 | KEGG COMPOUND |
| DB01057 | DrugBank |
| Echothiophate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1794025 | Beilstein |
| CAS:6736-03-4 | ChemIDplus |
| CAS:6736-03-4 | KEGG COMPOUND |
| Citations |
|---|