EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H23NO3PS |
| Net Charge | +1 |
| Average Mass | 256.328 |
| Monoisotopic Mass | 256.11308 |
| SMILES | CCOP(=O)(OCC)SCC[N+](C)(C)C |
| InChI | InChI=1S/C9H23NO3PS/c1-6-12-14(11,13-7-2)15-9-8-10(3,4)5/h6-9H2,1-5H3/q+1 |
| InChIKey | BJOLKYGKSZKIGU-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | miotic An agent causing contraction of the pupil of the eye. Because the size of the pupil is under the antagonistic control of the sympathetic and parasympathetic systems, drugs affecting either system can cause miosis. Drugs that mimic or potentiate the parasympathetic input to the circular constrictor muscle and drugs that inhibit sympathetic input to the radial dilator muscle tend to contract the pupils. EC 3.1.1.8 (cholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of cholinesterase (EC 3.1.1.8). |
| Application: | miotic An agent causing contraction of the pupil of the eye. Because the size of the pupil is under the antagonistic control of the sympathetic and parasympathetic systems, drugs affecting either system can cause miosis. Drugs that mimic or potentiate the parasympathetic input to the circular constrictor muscle and drugs that inhibit sympathetic input to the radial dilator muscle tend to contract the pupils. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ecothiopate (CHEBI:4753) has role EC 3.1.1.8 (cholinesterase) inhibitor (CHEBI:37733) |
| ecothiopate (CHEBI:4753) has role miotic (CHEBI:51068) |
| ecothiopate (CHEBI:4753) is a organic thiophosphate (CHEBI:37512) |
| ecothiopate (CHEBI:4753) is a phosphocholines (CHEBI:36700) |
| ecothiopate (CHEBI:4753) is a quaternary ammonium ion (CHEBI:35267) |
| Incoming Relation(s) |
| ecothiopate iodide (CHEBI:59849) has part ecothiopate (CHEBI:4753) |
| IUPAC Name |
|---|
| 2-[(diethoxyphosphoryl)sulfanyl]-N,N,N-trimethylethanaminium |
| INNs | Source |
|---|---|
| ecothiopate | ChEBI |
| ecothiopatum | ChEBI |
| Synonyms | Source |
|---|---|
| (2-diethoxyphosphinylthioethyl)trimethylammonium | ChEBI |
| Echothiophate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 982 | DrugCentral |
| C06975 | KEGG COMPOUND |
| DB01057 | DrugBank |
| Echothiophate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1794025 | Beilstein |
| CAS:6736-03-4 | KEGG COMPOUND |
| CAS:6736-03-4 | ChemIDplus |