EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H23NO |
| Net Charge | 0 |
| Average Mass | 281.399 |
| Monoisotopic Mass | 281.17796 |
| SMILES | CN1CCC(OC(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C19H23NO/c1-20-14-12-18(13-15-20)21-19(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-11,18-19H,12-15H2,1H3 |
| InChIKey | OWQUZNMMYNAXSL-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| Applications: | cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diphenylpyraline (CHEBI:59788) has role cholinergic antagonist (CHEBI:48873) |
| diphenylpyraline (CHEBI:59788) has role H1-receptor antagonist (CHEBI:37955) |
| diphenylpyraline (CHEBI:59788) is a piperidines (CHEBI:26151) |
| diphenylpyraline (CHEBI:59788) is a tertiary amine (CHEBI:32876) |
| Incoming Relation(s) |
| diphenylpyraline hydrochloride (CHEBI:31508) has part diphenylpyraline (CHEBI:59788) |
| IUPAC Name |
|---|
| 4-(diphenylmethoxy)-1-methylpiperidine |
| INNs | Source |
|---|---|
| diphenylpyralinum | ChemIDplus |
| difenilpiralina | ChemIDplus |
| diphenylpyraline | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-methyl-4-piperidyl benzhydryl ether | ChemIDplus |
| 4-(benzhydryloxy)-1-methylpiperidine | ChemIDplus |
| 1-methyl-4-hydroxypiperidine benzhydryl ether | ChEBI |
| 4-(benzhydryloxy)-N-methylpiperidine | ChEBI |
| diphenylpyralamine | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| D07862 | KEGG DRUG |
| DB01146 | DrugBank |
| US2479843 | Patent |
| Diphenylpyraline | Wikipedia |
| HMDB0015277 | HMDB |
| LSM-5385 | LINCS |
| 920 | DrugCentral |
| Citations |
|---|