EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:31508 - diphenylpyraline hydrochloride
| Formula | C19H24NO.Cl |
| Net Charge | 0 |
| Average Mass | 317.860 |
| Monoisotopic Mass | 317.15464 |
| SMILES | C[NH+]1CCC(OC(c2ccccc2)c2ccccc2)CC1.[Cl-] |
| InChI | InChI=1S/C19H23NO.ClH/c1-20-14-12-18(13-15-20)21-19(16-8-4-2-5-9-16)17-10-6-3-7-11-17;/h2-11,18-19H,12-15H2,1H3;1H |
| InChIKey | LPRLDRXGWKXRMQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. |
| Applications: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diphenylpyraline hydrochloride (CHEBI:31508) has part diphenylpyraline (CHEBI:59788) |
| diphenylpyraline hydrochloride (CHEBI:31508) has role cholinergic antagonist (CHEBI:48873) |
| diphenylpyraline hydrochloride (CHEBI:31508) has role H1-receptor antagonist (CHEBI:37955) |
| diphenylpyraline hydrochloride (CHEBI:31508) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 4-(diphenylmethoxy)-1-methylpiperidinium chloride |
| Synonyms | Source |
|---|---|
| 4-(diphenylmethoxy)-1-methylpiperidine hydrochloride | IUPAC |
| diphenylpyraline HCl | ChemIDplus |
| 1-methylpiperidyl-4-benzhydrylether hydrochloride | ChemIDplus |
| 1-methyl-4-piperidyl benzhydryl ether hydrochloride | ChemIDplus |
| Citations |
|---|