EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24NO.Cl |
| Net Charge | 0 |
| Average Mass | 317.860 |
| Monoisotopic Mass | 317.15464 |
| SMILES | C[NH+]1CCC(OC(c2ccccc2)c2ccccc2)CC1.[Cl-] |
| InChI | InChI=1S/C19H23NO.ClH/c1-20-14-12-18(13-15-20)21-19(16-8-4-2-5-9-16)17-10-6-3-7-11-17;/h2-11,18-19H,12-15H2,1H3;1H |
| InChIKey | LPRLDRXGWKXRMQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| Applications: | cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diphenylpyraline hydrochloride (CHEBI:31508) has part diphenylpyraline (CHEBI:59788) |
| diphenylpyraline hydrochloride (CHEBI:31508) has role cholinergic antagonist (CHEBI:48873) |
| diphenylpyraline hydrochloride (CHEBI:31508) has role H1-receptor antagonist (CHEBI:37955) |
| diphenylpyraline hydrochloride (CHEBI:31508) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 4-(diphenylmethoxy)-1-methylpiperidinium chloride |
| Synonyms | Source |
|---|---|
| 1-methyl-4-piperidyl benzhydryl ether hydrochloride | ChemIDplus |
| 1-methylpiperidyl-4-benzhydrylether hydrochloride | ChemIDplus |
| 4-(diphenylmethoxy)-1-methylpiperidine hydrochloride | IUPAC |
| diphenylpyraline HCl | ChemIDplus |
| Citations |
|---|