EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H33N2O2.Cl |
| Net Charge | 0 |
| Average Mass | 489.059 |
| Monoisotopic Mass | 488.22306 |
| SMILES | CCOC(=O)C1(c2ccccc2)CC[NH+](CCC(C#N)(c2ccccc2)c2ccccc2)CC1.[Cl-] |
| InChI | InChI=1S/C30H32N2O2.ClH/c1-2-34-28(33)29(25-12-6-3-7-13-25)18-21-32(22-19-29)23-20-30(24-31,26-14-8-4-9-15-26)27-16-10-5-11-17-27;/h3-17H,2,18-23H2,1H3;1H |
| InChIKey | SHTAFWKOISOCBI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antidiarrhoeal drug Any drug found useful in the symptomatic treatment of diarrhoea. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diphenoxylate hydrochloride (CHEBI:59784) has part diphenoxylate (CHEBI:4639) |
| diphenoxylate hydrochloride (CHEBI:59784) has role antidiarrhoeal drug (CHEBI:55323) |
| diphenoxylate hydrochloride (CHEBI:59784) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 1-(3-cyano-3,3-diphenylpropyl)-4-(ethoxycarbonyl)-4-phenylpiperidinium chloride |
| Synonyms | Source |
|---|---|
| 1-(3-cyano-3,3-diphenylpropyl)-4-phenylisonipecotic acid ethyl ester hydrochloride | ChemIDplus |
| 4-ethoxycarbonyl-α,α,4-triphenyl-1-piperidinebutyronitrile hydrochloride | NIST Chemistry WebBook |
| diphenoxylate HCl | ChemIDplus |
| ethyl 1-(3-cyano-3,3-diphenylpropyl)-4-phenylisonipecotate monohydrochloride | ChemIDplus |
| ethyl 1-(3-cyano-3,3-diphenylpropyl)-4-phenylpiperidine-4-carboxylate hydrochloride | IUPAC |