EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H32N2O2 |
| Net Charge | 0 |
| Average Mass | 452.598 |
| Monoisotopic Mass | 452.24638 |
| SMILES | CCOC(=O)C1(c2ccccc2)CCN(CCC(C#N)(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C30H32N2O2/c1-2-34-28(33)29(25-12-6-3-7-13-25)18-21-32(22-19-29)23-20-30(24-31,26-14-8-4-9-15-26)27-16-10-5-11-17-27/h3-17H,2,18-23H2,1H3 |
| InChIKey | HYPPXZBJBPSRLK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antidiarrhoeal drug Any drug found useful in the symptomatic treatment of diarrhoea. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diphenoxylate (CHEBI:4639) has functional parent difenoxin (CHEBI:4534) |
| diphenoxylate (CHEBI:4639) has role antidiarrhoeal drug (CHEBI:55323) |
| diphenoxylate (CHEBI:4639) is a ethyl ester (CHEBI:23990) |
| diphenoxylate (CHEBI:4639) is a nitrile (CHEBI:18379) |
| diphenoxylate (CHEBI:4639) is a piperidinecarboxylate ester (CHEBI:48630) |
| diphenoxylate (CHEBI:4639) is a tertiary amine (CHEBI:32876) |
| Incoming Relation(s) |
| diphenoxylate hydrochloride (CHEBI:59784) has part diphenoxylate (CHEBI:4639) |
| IUPAC Name |
|---|
| ethyl 1-(3-cyano-3,3-diphenylpropyl)-4-phenylpiperidine-4-carboxylate |
| INNs | Source |
|---|---|
| difenoxilato | ChemIDplus |
| diphenoxylate | ChemIDplus |
| diphenoxylatum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-(3-cyano-3,3-diphenylpropyl)-4-phenyl-isonipecotic acid ethyl ester | NIST Chemistry WebBook |
| 2,2-diphenyl-4-(4-carbethoxy-4-phenylpiperidino)butyronitrile | ChemIDplus |
| 4-ethoxycarbonyl-α,α,4-triphenyl-1-piperidinebutyronitrile | ChEBI |
| ethyl 1-(3-cyano-3,3-diphenylpropyl)-4-phenyl-4-piperidinecarboxylate | NIST Chemistry WebBook |
| ethyl 1-(3-cyano-3,3-diphenylpropyl)-4-phenylisonipecotate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 918 | DrugCentral |
| C07872 | KEGG COMPOUND |
| D07861 | KEGG DRUG |
| DB01081 | DrugBank |
| Diphenoxylate | Wikipedia |
| HMDB0015213 | HMDB |
| LSM-5534 | LINCS |
| US2898340 | Patent |