EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O3 |
| Net Charge | 0 |
| Average Mass | 132.159 |
| Monoisotopic Mass | 132.07864 |
| SMILES | CC(C)CC(O)C(=O)O |
| InChI | InChI=1S/C6H12O3/c1-4(2)3-5(7)6(8)9/h4-5,7H,3H2,1-2H3,(H,8,9) |
| InChIKey | LVRFTAZAXQPQHI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxy-4-methylvaleric acid (CHEBI:59783) has functional parent valeric acid (CHEBI:17418) |
| 2-hydroxy-4-methylvaleric acid (CHEBI:59783) has role metabolite (CHEBI:25212) |
| 2-hydroxy-4-methylvaleric acid (CHEBI:59783) is a 2-hydroxy fatty acid (CHEBI:10283) |
| 2-hydroxy-4-methylvaleric acid (CHEBI:59783) is a branched-chain fatty acid (CHEBI:35819) |
| 2-hydroxy-4-methylvaleric acid (CHEBI:59783) is conjugate acid of 2-hydroxy-4-methylvalerate (CHEBI:133577) |
| Incoming Relation(s) |
| (R)-2-hydroxy-4-methylpentanoic acid (CHEBI:55534) is a 2-hydroxy-4-methylvaleric acid (CHEBI:59783) |
| (S)-2-hydroxy-4-methylpentanoic acid (CHEBI:44510) is a 2-hydroxy-4-methylvaleric acid (CHEBI:59783) |
| 2-hydroxy-4-methylvalerate (CHEBI:133577) is conjugate base of 2-hydroxy-4-methylvaleric acid (CHEBI:59783) |
| IUPAC Name |
|---|
| 2-hydroxy-4-methylpentanoic acid |
| Synonyms | Source |
|---|---|
| alpha-Hydroxyisocaproic acid | ChEBI |
| Leucic acid | ChemIDplus |
| 2-hydroxyisocaproic acid | ChEBI |
| 2-hydroxyisohexanoic acid | ChEBI |
| leucinic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0000665 | HMDB |
| LMFA01050381 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1721733 | Reaxys |
| CAS:498-36-2 | ChemIDplus |
| Citations |
|---|