EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11O3 |
| Net Charge | -1 |
| Average Mass | 131.151 |
| Monoisotopic Mass | 131.07137 |
| SMILES | CC(C)CC(O)C(=O)[O-] |
| InChI | InChI=1S/C6H12O3/c1-4(2)3-5(7)6(8)9/h4-5,7H,3H2,1-2H3,(H,8,9)/p-1 |
| InChIKey | LVRFTAZAXQPQHI-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxy-4-methylvalerate (CHEBI:133577) has functional parent valeric acid (CHEBI:17418) |
| 2-hydroxy-4-methylvalerate (CHEBI:133577) has role metabolite (CHEBI:25212) |
| 2-hydroxy-4-methylvalerate (CHEBI:133577) is a 2-hydroxy fatty acid anion (CHEBI:76176) |
| 2-hydroxy-4-methylvalerate (CHEBI:133577) is a methyl-branched fatty acid anion (CHEBI:67013) |
| 2-hydroxy-4-methylvalerate (CHEBI:133577) is conjugate base of 2-hydroxy-4-methylvaleric acid (CHEBI:59783) |
| Incoming Relation(s) |
| (R)-2-hydroxy-4-methylpentanoate (CHEBI:55535) is a 2-hydroxy-4-methylvalerate (CHEBI:133577) |
| 2-hydroxy-4-methylvaleric acid (CHEBI:59783) is conjugate acid of 2-hydroxy-4-methylvalerate (CHEBI:133577) |
| IUPAC Name |
|---|
| 2-hydroxy-4-methylpentanoate |
| Synonyms | Source |
|---|---|
| 2-hydroxyisocaproate | ChEBI |
| α-hydroxyisocaproate | ChEBI |
| UniProt Name | Source |
|---|---|
| 2-hydroxy-4-methylpentanoate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5729843 | Reaxys |