EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H15O11 |
| Net Charge | -1 |
| Average Mass | 467.362 |
| Monoisotopic Mass | 467.06198 |
| SMILES | O=C([O-])c1cc(=O)c2c(OCC(O)COc3cccc4oc(C(=O)O)cc(=O)c34)cccc2o1 |
| InChI | InChI=1S/C23H16O11/c24-11(9-31-14-3-1-5-16-20(14)12(25)7-18(33-16)22(27)28)10-32-15-4-2-6-17-21(15)13(26)8-19(34-17)23(29)30/h1-8,11,24H,9-10H2,(H,27,28)(H,29,30)/p-1 |
| InChIKey | IMZMKUWMOSJXDT-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cromoglycate(1−) (CHEBI:59774) is a dicarboxylic acid monoanion (CHEBI:35695) |
| cromoglycate(1−) (CHEBI:59774) is conjugate acid of cromoglycate(2−) (CHEBI:59039) |
| cromoglycate(1−) (CHEBI:59774) is conjugate base of cromoglycic acid (CHEBI:59773) |
| Incoming Relation(s) |
| cromoglycic acid (CHEBI:59773) is conjugate acid of cromoglycate(1−) (CHEBI:59774) |
| cromoglycate(2−) (CHEBI:59039) is conjugate base of cromoglycate(1−) (CHEBI:59774) |