EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H16O11 |
| Net Charge | 0 |
| Average Mass | 468.370 |
| Monoisotopic Mass | 468.06926 |
| SMILES | O=C(O)c1cc(=O)c2c(OCC(O)COc3cccc4oc(C(=O)O)cc(=O)c34)cccc2o1 |
| InChI | InChI=1S/C23H16O11/c24-11(9-31-14-3-1-5-16-20(14)12(25)7-18(33-16)22(27)28)10-32-15-4-2-6-17-21(15)13(26)8-19(34-17)23(29)30/h1-8,11,24H,9-10H2,(H,27,28)(H,29,30) |
| InChIKey | IMZMKUWMOSJXDT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | calcium channel blocker One of a class of drugs that acts by selective inhibition of calcium influx through cell membranes or on the release and binding of calcium in intracellular pools. |
| Applications: | anti-asthmatic drug A drug used to treat asthma. nasal decongestant A drug used to relieve nasal congestion in the upper respiratory tract. antipsoriatic A drug used to treat psoriasis. dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cromoglycic acid (CHEBI:59773) has role anti-asthmatic drug (CHEBI:49167) |
| cromoglycic acid (CHEBI:59773) has role antipsoriatic (CHEBI:50748) |
| cromoglycic acid (CHEBI:59773) has role antipsychotic agent (CHEBI:35476) |
| cromoglycic acid (CHEBI:59773) has role calcium channel blocker (CHEBI:38215) |
| cromoglycic acid (CHEBI:59773) has role dermatologic drug (CHEBI:50177) |
| cromoglycic acid (CHEBI:59773) has role nasal decongestant (CHEBI:77715) |
| cromoglycic acid (CHEBI:59773) is a chromones (CHEBI:23238) |
| cromoglycic acid (CHEBI:59773) is a dicarboxylic acid (CHEBI:35692) |
| cromoglycic acid (CHEBI:59773) is conjugate acid of cromoglycate(1−) (CHEBI:59774) |
| Incoming Relation(s) |
| cromoglycate(1−) (CHEBI:59774) is conjugate base of cromoglycic acid (CHEBI:59773) |
| IUPAC Name |
|---|
| 5,5'-[(2-hydroxypropane-1,3-diyl)bis(oxy)]bis(4-oxo-4H-chromene-2-carboxylic acid) |
| INNs | Source |
|---|---|
| acide cromoglicique | ChemIDplus |
| acido cromoglicico | ChemIDplus |
| acidum cromoglicicum | ChemIDplus |
| cromoglicic acid | ChemIDplus |
| Synonyms | Source |
|---|---|
| 5-[3-(2-carboxy-4-oxo-4H-5-chromenyloxy)-2-hydroxypropoxy]-4-oxo-4H-2-chromenecarboxylic acid | ChEMBL |
| Cromo-comod | ChEMBL |
| Cromoglicic acid | KEGG COMPOUND |
| cromolyn | ChEMBL |
| Cromolyn | ChemIDplus |
| R03BC01 | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1336926 | Reaxys |
| CAS:16110-51-3 | KEGG COMPOUND |
| CAS:16110-51-3 | ChemIDplus |
| Citations |
|---|