EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H16O11 |
| Net Charge | 0 |
| Average Mass | 468.370 |
| Monoisotopic Mass | 468.06926 |
| SMILES | O=C(O)c1cc(=O)c2c(OCC(O)COc3cccc4oc(C(=O)O)cc(=O)c34)cccc2o1 |
| InChI | InChI=1S/C23H16O11/c24-11(9-31-14-3-1-5-16-20(14)12(25)7-18(33-16)22(27)28)10-32-15-4-2-6-17-21(15)13(26)8-19(34-17)23(29)30/h1-8,11,24H,9-10H2,(H,27,28)(H,29,30) |
| InChIKey | IMZMKUWMOSJXDT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | calcium channel blocker One of a class of drugs that acts by selective inhibition of calcium influx through cell membranes or on the release and binding of calcium in intracellular pools. |
| Application: | anti-asthmatic drug A drug used to treat asthma. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cromoglycic acid (CHEBI:59773) has role anti-asthmatic drug (CHEBI:49167) |
| cromoglycic acid (CHEBI:59773) has role calcium channel blocker (CHEBI:38215) |
| cromoglycic acid (CHEBI:59773) is a chromones (CHEBI:23238) |
| cromoglycic acid (CHEBI:59773) is a dicarboxylic acid (CHEBI:35692) |
| cromoglycic acid (CHEBI:59773) is conjugate acid of cromoglycate(1−) (CHEBI:59774) |
| Incoming Relation(s) |
| cromoglycate(1−) (CHEBI:59774) is conjugate base of cromoglycic acid (CHEBI:59773) |
| IUPAC Name |
|---|
| 5,5'-[(2-hydroxypropane-1,3-diyl)bis(oxy)]bis(4-oxo-4H-chromene-2-carboxylic acid) |
| INNs | Source |
|---|---|
| acide cromoglicique | ChemIDplus |
| acido cromoglicico | ChemIDplus |
| acidum cromoglicicum | ChemIDplus |
| cromoglicic acid | ChemIDplus |
| Synonyms | Source |
|---|---|
| 5-[3-(2-carboxy-4-oxo-4H-5-chromenyloxy)-2-hydroxypropoxy]-4-oxo-4H-2-chromenecarboxylic acid | ChEMBL |
| Cromoglicic acid | KEGG COMPOUND |
| Cromolyn | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1336926 | Reaxys |
| CAS:16110-51-3 | ChemIDplus |
| CAS:16110-51-3 | KEGG COMPOUND |
| Citations |
|---|