EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:59750 - diflorasone
| Formula | C22H28F2O5 |
| Net Charge | 0 |
| Average Mass | 410.457 |
| Monoisotopic Mass | 410.19048 |
| SMILES | [H][C@@]12C[C@H](C)[C@](O)(C(=O)CO)[C@@]1(C)C[C@H](O)[C@@]1(F)[C@@]2([H])C[C@H](F)C2=CC(=O)C=C[C@@]21C |
| InChI | InChI=1S/C22H28F2O5/c1-11-6-13-14-8-16(23)15-7-12(26)4-5-19(15,2)21(14,24)17(27)9-20(13,3)22(11,29)18(28)10-25/h4-5,7,11,13-14,16-17,25,27,29H,6,8-10H2,1-3H3/t11-,13-,14-,16-,17-,19-,20-,21-,22-/m0/s1 |
| InChIKey | WXURHACBFYSXBI-XHIJKXOTSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| Application: | anti-inflammatory drug A substance that reduces or suppresses inflammation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diflorasone (CHEBI:59750) has parent hydride pregnane (CHEBI:8386) |
| diflorasone (CHEBI:59750) has role anti-inflammatory drug (CHEBI:35472) |
| diflorasone (CHEBI:59750) is a 11β-hydroxy steroid (CHEBI:35346) |
| diflorasone (CHEBI:59750) is a 17α-hydroxy steroid (CHEBI:35342) |
| diflorasone (CHEBI:59750) is a 20-oxo steroid (CHEBI:36885) |
| diflorasone (CHEBI:59750) is a 21-hydroxy steroid (CHEBI:35344) |
| diflorasone (CHEBI:59750) is a 3-oxo-Δ1,Δ4-steroid (CHEBI:77166) |
| diflorasone (CHEBI:59750) is a fluorinated steroid (CHEBI:50830) |
| diflorasone (CHEBI:59750) is a glucocorticoid (CHEBI:24261) |
| diflorasone (CHEBI:59750) is a primary α-hydroxy ketone (CHEBI:139590) |
| diflorasone (CHEBI:59750) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| Incoming Relation(s) |
| diflorasone diacetate (CHEBI:31483) has functional parent diflorasone (CHEBI:59750) |
| IUPAC Name |
|---|
| 6α,9-difluoro-11β,17,21-trihydroxy-16β-methylpregna-1,4-diene-3,20-dione |
| INNs | Source |
|---|---|
| diflorasona | ChemIDplus |
| diflorasone | ChemIDplus |
| diflorasonum | ChemIDplus |
| Synonym | Source |
|---|---|
| (6α,11β,16β)-6,9-difluoro-11,17,21-trihydroxy-16-methylpregna-1,4-diene-3,20-dione | ChEBI |