EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H17NO5 |
| Net Charge | 0 |
| Average Mass | 195.215 |
| Monoisotopic Mass | 195.11067 |
| SMILES | CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C7H17NO5/c1-8-2-4(10)6(12)7(13)5(11)3-9/h4-13H,2-3H2,1H3/t4-,5+,6+,7+/m0/s1 |
| InChIKey | MBBZMMPHUWSWHV-BDVNFPICSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. |
| Application: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-methylglucamine (CHEBI:59732) has role antileishmanial agent (CHEBI:70868) |
| N-methylglucamine (CHEBI:59732) is a hexosamine (CHEBI:24586) |
| N-methylglucamine (CHEBI:59732) is a secondary amino compound (CHEBI:50995) |
| Incoming Relation(s) |
| meglumine amidotrizoate (CHEBI:31812) has part N-methylglucamine (CHEBI:59732) |
| IUPAC Name |
|---|
| 1-deoxy-1-(methylamino)-D-glucitol |
| INNs | Source |
|---|---|
| meglumina | ChemIDplus |
| meglumine | ChemIDplus |
| méglumine | WHO MedNet |
| megluminum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-deoxy-1-methylaminosorbitol | ChemIDplus |
| D(-)-n-methylglucamine | ChEMBL |
| N-methyl-D-glucamine | ChemIDplus |
| meglumine | ChEMBL |
| Methylglucamine | ChEMBL |
| N-methylglucamine | ChEMBL |
| Citations |
|---|