EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H8I3N2O4.C7H18NO5 |
| Net Charge | 0 |
| Average Mass | 809.130 |
| Monoisotopic Mass | 808.88032 |
| SMILES | CC(=O)Nc1c(I)c(NC(C)=O)c(I)c(C(=O)[O-])c1I.C[NH2+]C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C11H9I3N2O4.C7H17NO5/c1-3(17)15-9-6(12)5(11(19)20)7(13)10(8(9)14)16-4(2)18;1-8-2-4(10)6(12)7(13)5(11)3-9/h1-2H3,(H,15,17)(H,16,18)(H,19,20);4-13H,2-3H2,1H3/t;4-,5+,6+,7+/m.0/s1 |
| InChIKey | MIKKOBKEXMRYFQ-WZTVWXICSA-N |
| Roles Classification |
|---|
| Application: | radioopaque medium A substance having the property of absorbing, and therefore being opaque to, electromagnetic radiation, particularly X-rays. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| meglumine amidotrizoate (CHEBI:31812) has part N-methylglucamine (CHEBI:59732) |
| meglumine amidotrizoate (CHEBI:31812) has part amidotrizoic acid anion (CHEBI:59731) |
| meglumine amidotrizoate (CHEBI:31812) has role radioopaque medium (CHEBI:37338) |
| meglumine amidotrizoate (CHEBI:31812) is a monocarboxylic acid anion (CHEBI:35757) |
| IUPAC Name |
|---|
| 1-deoxy-1-(methylammonio)-D-glucitol 3,5-bis(acetylamino)-2,4,6-triiodobenzoate |
| Synonyms | Source |
|---|---|
| 1-deoxy-1-(methylamino)-D-glucitol 3,5-diacetamido-2,4,6-triiodobenzoate | ChemIDplus |
| amidotrizoate meglumine | ChemIDplus |
| diatrizoate methylglucamine | ChemIDplus |
| meglumine diatrizoate | ChemIDplus |
| methylglucamine diatrizoate | ChemIDplus |
| diatrizoate meglumine | ChemIDplus |