EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4HO4 |
| Net Charge | -1 |
| Average Mass | 113.048 |
| Monoisotopic Mass | 112.98803 |
| SMILES | O=c1c([O-])c(O)c1=O |
| InChI | InChI=1S/C4H2O4/c5-1-2(6)4(8)3(1)7/h5-6H/p-1 |
| InChIKey | PWEBUXCTKOWPCW-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hydrogensquarate (CHEBI:59711) is a carbon oxoanion (CHEBI:35604) |
| hydrogensquarate (CHEBI:59711) is conjugate acid of squarate (CHEBI:59712) |
| hydrogensquarate (CHEBI:59711) is conjugate base of squaric acid (CHEBI:52141) |
| Incoming Relation(s) |
| squaric acid (CHEBI:52141) is conjugate acid of hydrogensquarate (CHEBI:59711) |
| squarate (CHEBI:59712) is conjugate base of hydrogensquarate (CHEBI:59711) |
| IUPAC Name |
|---|
| 2-hydroxy-3,4-dioxocyclobut-1-en-1-olate |
| Synonyms | Source |
|---|---|
| hydrogensquarate anion | ChEBI |
| squarate(1−) | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4177223 | Beilstein |