EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H2O4 |
| Net Charge | 0 |
| Average Mass | 114.056 |
| Monoisotopic Mass | 113.99531 |
| SMILES | O=c1c(O)c(O)c1=O |
| InChI | InChI=1S/C4H2O4/c5-1-2(6)4(8)3(1)7/h5-6H |
| InChIKey | PWEBUXCTKOWPCW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| squaric acid (CHEBI:52141) has role metabolite (CHEBI:25212) |
| squaric acid (CHEBI:52141) is a alicyclic ketone (CHEBI:36132) |
| squaric acid (CHEBI:52141) is a carbon oxoacid (CHEBI:35605) |
| squaric acid (CHEBI:52141) is conjugate acid of hydrogensquarate (CHEBI:59711) |
| Incoming Relation(s) |
| squaric acid dibutyl ester (CHEBI:53612) has functional parent squaric acid (CHEBI:52141) |
| hydrogensquarate (CHEBI:59711) is conjugate base of squaric acid (CHEBI:52141) |
| IUPAC Name |
|---|
| 3,4-dihydroxycyclobut-3-ene-1,2-dione |
| Synonyms | Source |
|---|---|
| 1,2-Diketo-3,4-dihydroxycyclobutene | ChemIDplus |
| 1,2-dioxo-3,4-dihydroxycyclobut-3-ene | ChEBI |
| 1,2-dioxo-3,4-dihydroxycyclobutene | ChEBI |
| 3,4-dihydroxy-3-cyclobutene-1,2-dione | NIST Chemistry WebBook |
| Quadratic acid | ChemIDplus |
| Quadratsäure | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Squaric_acid | Wikipedia |