EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H38N4O6.HCl |
| Net Charge | 0 |
| Average Mass | 623.150 |
| Monoisotopic Mass | 622.25581 |
| SMILES | CCc1c2c(nc3ccc(OC(=O)N4CCC(N5CCCCC5)CC4)cc13)-c1cc3c(c(=O)n1C2)COC(=O)[C@]3(O)CC.Cl |
| InChI | InChI=1S/C33H38N4O6.ClH/c1-3-22-23-16-21(43-32(40)36-14-10-20(11-15-36)35-12-6-5-7-13-35)8-9-27(23)34-29-24(22)18-37-28(29)17-26-25(30(37)38)19-42-31(39)33(26,41)4-2;/h8-9,16-17,20,41H,3-7,10-15,18-19H2,1-2H3;1H/t33-;/m0./s1 |
| InChIKey | GURKHSYORGJETM-WAQYZQTGSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. EC 5.99.1.2 (DNA topoisomerase) inhibitor A topoisomerase inhibitor that inhibits the bacterial enzymes of the DNA topoisomerases, Type I class (EC 5.99.1.2) that catalyze ATP-independent breakage of one of the two strands of DNA, passage of the unbroken strand through the break, and rejoining of the broken strand. These bacterial enzymes reduce the topological stress in the DNA structure by relaxing negatively, but not positively, supercoiled DNA. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| irinotecan hydrochloride (anhydrous) (CHEBI:5971) has part irinotecan(1+) (CHEBI:90895) |
| irinotecan hydrochloride (anhydrous) (CHEBI:5971) has role antineoplastic agent (CHEBI:35610) |
| irinotecan hydrochloride (anhydrous) (CHEBI:5971) has role apoptosis inducer (CHEBI:68495) |
| irinotecan hydrochloride (anhydrous) (CHEBI:5971) has role EC 5.99.1.2 (DNA topoisomerase) inhibitor (CHEBI:50276) |
| irinotecan hydrochloride (anhydrous) (CHEBI:5971) has role prodrug (CHEBI:50266) |
| irinotecan hydrochloride (anhydrous) (CHEBI:5971) is a hydrochloride (CHEBI:36807) |
| Incoming Relation(s) |
| irinotecan hydrochloride hydrate (CHEBI:90881) has part irinotecan hydrochloride (anhydrous) (CHEBI:5971) |
| IUPAC Names |
|---|
| 1-[1-({[(4S)-4,11-diethyl-4-hydroxy-3,14-dioxo-3,4,12,14-tetrahydro-1H-pyrano[3',4':6,7]indolizino[1,2-b]quinolin-9-yl]oxy}carbonyl)piperidin-4-yl]piperidin-1-ium chloride |
| (4S)-4,11-diethyl-4-hydroxy-3,14-dioxo-3,4,12,14-tetrahydro-1H-pyrano[3',4':6,7]indolizino[1,2-b]quinolin-9-yl [1,4'-bipiperidine]-1'-carboxylate hydrochloride |
| Synonyms | Source |
|---|---|
| 7-Ethyl-10-(4-(1-piperidino)-1-piperidino)carbonyloxy camptothecin hydrochloride | ChemIDplus |
| Camptothecin 11 hydrochloride | ChemIDplus |
| CPT 11 | ChemIDplus |
| CPT-11 | ChemIDplus |
| Irinotecan HCl | ChemIDplus |
| Irinotecan hydrochloride | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| DB00762 | DrugBank |
| Irinotecan | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4837793 | Reaxys |
| CAS:100286-90-6 | ChemIDplus |
| Citations |
|---|