EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C57H102N16O28S5R |
| Net Charge | -5 |
| Average Mass (excl. R groups) | 1619.843 |
| Monoisotopic Mass (excl. R groups) | 1618.56530 |
| SMILES | *C[C@@H](C)CCCCC(=O)N[C@@H](CCNCS(=O)(=O)[O-])C(=O)N[C@H](C(=O)N[C@@H](CCNCS(=O)(=O)[O-])C(=O)N[C@H]1CCNC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](CCNCS(=O)(=O)[O-])NC(=O)[C@H](CCNCS(=O)(=O)[O-])NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CCNCS(=O)(=O)[O-])NC1=O)[C@@H](C)O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| colistimethate(5−) (CHEBI:59661) has part colistimethate A(5−) (CHEBI:59666) |
| colistimethate(5−) (CHEBI:59661) has part colistimethate B(5−) (CHEBI:59667) |
| colistimethate(5−) (CHEBI:59661) is a organosulfonate oxoanion (CHEBI:33554) |
| colistimethate(5−) (CHEBI:59661) is conjugate base of colistimethate (CHEBI:59662) |
| Incoming Relation(s) |
| colistimethate sodium (CHEBI:34650) has part colistimethate(5−) (CHEBI:59661) |
| colistimethate (CHEBI:59662) is conjugate acid of colistimethate(5−) (CHEBI:59661) |
| Synonyms | Source |
|---|---|
| colistimethate penta-anion | ChEBI |
| colistin methanesulfonate(5−) | ChEBI |