EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H9Cl2NO3 |
| Net Charge | 0 |
| Average Mass | 310.136 |
| Monoisotopic Mass | 308.99595 |
| SMILES | O=C1C=C/C(=N\c2c(Cl)cccc2Cl)C(CC(=O)O)=C1 |
| InChI | InChI=1S/C14H9Cl2NO3/c15-10-2-1-3-11(16)14(10)17-12-5-4-9(18)6-8(12)7-13(19)20/h1-6H,7H2,(H,19,20)/b17-12+ |
| InChIKey | GTSUHSLLLCOPRM-SFQUDFHCSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-hydroxydiclofenac quinone imine (CHEBI:59611) has functional parent diclofenac (CHEBI:47381) |
| 5-hydroxydiclofenac quinone imine (CHEBI:59611) has role drug metabolite (CHEBI:49103) |
| 5-hydroxydiclofenac quinone imine (CHEBI:59611) is a dichlorobenzene (CHEBI:23697) |
| 5-hydroxydiclofenac quinone imine (CHEBI:59611) is a monocarboxylic acid (CHEBI:25384) |
| 5-hydroxydiclofenac quinone imine (CHEBI:59611) is a quinone imine (CHEBI:50193) |
| IUPAC Name |
|---|
| {(6E)-6-[(2,6-dichlorophenyl)imino]-3-oxocyclohexa-1,4-dien-1-yl}acetic acid |
| Synonym | Source |
|---|---|
| 5-hydroxy diclofenac benzoquinone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8851517 | Reaxys |
| Citations |
|---|