EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H9Cl2NO3 |
| Net Charge | 0 |
| Average Mass | 310.136 |
| Monoisotopic Mass | 308.99595 |
| SMILES | O=C1C=C(Cl)C(=Nc2ccccc2CC(=O)O)C(Cl)=C1 |
| InChI | InChI=1S/C14H9Cl2NO3/c15-10-6-9(18)7-11(16)14(10)17-12-4-2-1-3-8(12)5-13(19)20/h1-4,6-7H,5H2,(H,19,20) |
| InChIKey | SKLQQURDEJYWEY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4'-hydroxydiclofenac quinone imine (CHEBI:59610) has functional parent diclofenac (CHEBI:47381) |
| 4'-hydroxydiclofenac quinone imine (CHEBI:59610) has role metabolite (CHEBI:25212) |
| 4'-hydroxydiclofenac quinone imine (CHEBI:59610) is a organochlorine compound (CHEBI:36683) |
| 4'-hydroxydiclofenac quinone imine (CHEBI:59610) is a quinone imine (CHEBI:50193) |
| IUPAC Name |
|---|
| {2-[(2,6-dichloro-4-oxocyclohexa-2,5-dien-1-ylidene)amino]phenyl}acetic acid |
| Synonym | Source |
|---|---|
| 4'-hydroxy diclofenac benzoquinone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10683401 | Reaxys |
| Citations |
|---|