EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H36ClFO5 |
| Net Charge | 0 |
| Average Mass | 495.031 |
| Monoisotopic Mass | 494.22353 |
| SMILES | [H][C@@]12C[C@H](F)C3=CC(=O)C=C[C@]3(C)[C@@]1(Cl)[C@@H](O)C[C@]1(C)[C@@H](C(=O)COC(=O)C(C)(C)C)[C@H](C)C[C@@]21[H] |
| InChI | InChI=1S/C27H36ClFO5/c1-14-9-16-17-11-19(29)18-10-15(30)7-8-26(18,6)27(17,28)21(32)12-25(16,5)22(14)20(31)13-34-23(33)24(2,3)4/h7-8,10,14,16-17,19,21-22,32H,9,11-13H2,1-6H3/t14-,16+,17+,19+,21+,22-,25+,26+,27+/m1/s1 |
| InChIKey | SXYZQZLHAIHKKY-GSTUPEFVSA-N |
| Roles Classification |
|---|
| Biological Role: | hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| Applications: | anti-inflammatory drug A substance that reduces or suppresses inflammation. antipruritic drug A drug, usually applied topically, that relieves pruritus (itching). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clocortolone pivalate (CHEBI:59583) has functional parent clocortolone (CHEBI:59582) |
| clocortolone pivalate (CHEBI:59583) has role anti-inflammatory drug (CHEBI:35472) |
| clocortolone pivalate (CHEBI:59583) has role antipruritic drug (CHEBI:59683) |
| clocortolone pivalate (CHEBI:59583) is a 11β-hydroxy steroid (CHEBI:35346) |
| clocortolone pivalate (CHEBI:59583) is a 20-oxo steroid (CHEBI:36885) |
| clocortolone pivalate (CHEBI:59583) is a 3-oxo-Δ1,Δ4-steroid (CHEBI:77166) |
| clocortolone pivalate (CHEBI:59583) is a chlorinated steroid (CHEBI:77175) |
| clocortolone pivalate (CHEBI:59583) is a fluorinated steroid (CHEBI:50830) |
| clocortolone pivalate (CHEBI:59583) is a glucocorticoid (CHEBI:24261) |
| clocortolone pivalate (CHEBI:59583) is a pivalate ester (CHEBI:50784) |
| IUPAC Name |
|---|
| 9-chloro-6α-fluoro-11β-hydroxy-16α-methyl-3,20-dioxopregna-1,4-dien-21-yl 2,2-dimethylpropanoate |
| Synonyms | Source |
|---|---|
| 9-chloro-6α-fluoro-11β,21-dihydroxy-16α-methylpregna-1,4-diene-3,20-dione 21-pivalate | ChemIDplus |
| clocortolone 21-pivalate | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:34097-16-0 | KEGG DRUG |
| CAS:34097-16-0 | ChemIDplus |