EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:59582 - clocortolone
| Formula | C22H28ClFO4 |
| Net Charge | 0 |
| Average Mass | 410.913 |
| Monoisotopic Mass | 410.16602 |
| SMILES | [H][C@@]12C[C@H](F)C3=CC(=O)C=C[C@]3(C)[C@@]1(Cl)[C@@H](O)C[C@]1(C)[C@@H](C(=O)CO)[C@H](C)C[C@@]21[H] |
| InChI | InChI=1S/C22H28ClFO4/c1-11-6-13-14-8-16(24)15-7-12(26)4-5-21(15,3)22(14,23)18(28)9-20(13,2)19(11)17(27)10-25/h4-5,7,11,13-14,16,18-19,25,28H,6,8-10H2,1-3H3/t11-,13+,14+,16+,18+,19-,20+,21+,22+/m1/s1 |
| InChIKey | YMTMADLUXIRMGX-RFPWEZLHSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| Applications: | anti-inflammatory drug A substance that reduces or suppresses inflammation. antipruritic drug A drug, usually applied topically, that relieves pruritus (itching). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clocortolone (CHEBI:59582) has role anti-inflammatory drug (CHEBI:35472) |
| clocortolone (CHEBI:59582) has role antipruritic drug (CHEBI:59683) |
| clocortolone (CHEBI:59582) is a 11β-hydroxy steroid (CHEBI:35346) |
| clocortolone (CHEBI:59582) is a 20-oxo steroid (CHEBI:36885) |
| clocortolone (CHEBI:59582) is a 21-hydroxy steroid (CHEBI:35344) |
| clocortolone (CHEBI:59582) is a 3-oxo-Δ1,Δ4-steroid (CHEBI:77166) |
| clocortolone (CHEBI:59582) is a chlorinated steroid (CHEBI:77175) |
| clocortolone (CHEBI:59582) is a fluorinated steroid (CHEBI:50830) |
| clocortolone (CHEBI:59582) is a glucocorticoid (CHEBI:24261) |
| clocortolone (CHEBI:59582) is a primary α-hydroxy ketone (CHEBI:139590) |
| Incoming Relation(s) |
| clocortolone pivalate (CHEBI:59583) has functional parent clocortolone (CHEBI:59582) |
| IUPAC Name |
|---|
| 9-chloro-6α-fluoro-11β,21-dihydroxy-16α-methylpregna-1,4-diene-3,20-dione |
| INNs | Source |
|---|---|
| clocortolonum | ChemIDplus |
| clocortolone | ChemIDplus |
| clocortolona | ChemIDplus |
| Synonyms | Source |
|---|---|
| 9-chloro-6α-fluoro-16α-methyl-1,4-pregnadiene-11β,21-diol-3,20-dione | ChEBI |
| 9-chloro-6α-fluoro-11β,21-dihydroxy-16α-methyl-1,4-pregnadien-3,20-dione | ChEBI |