EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Br.C20H30NO3.H2O |
| Net Charge | 0 |
| Average Mass | 430.383 |
| Monoisotopic Mass | 429.15147 |
| SMILES | [Br-].[H]O[H].[H][C@]12CC[C@]([H])(C[C@H](OC(=O)C(CO)c3ccccc3)C1)[N@+]2(C)C(C)C |
| InChI | InChI=1S/C20H30NO3.BrH.H2O/c1-14(2)21(3)16-9-10-17(21)12-18(11-16)24-20(23)19(13-22)15-7-5-4-6-8-15;;/h4-8,14,16-19,22H,9-13H2,1-3H3;1H;1H2/q+1;;/p-1/t16-,17+,18+,19?,21+;; |
| InChIKey | KEWHKYJURDBRMN-ZEODDXGYSA-M |
| Roles Classification |
|---|
| Biological Role: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | bronchodilator agent An agent that causes an increase in the expansion of a bronchus or bronchial tubes. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ipratropium bromide hydrate (CHEBI:5957) has part ipratropium bromide (CHEBI:46659) |
| ipratropium bromide hydrate (CHEBI:5957) has role bronchodilator agent (CHEBI:35523) |
| ipratropium bromide hydrate (CHEBI:5957) has role muscarinic antagonist (CHEBI:48876) |
| ipratropium bromide hydrate (CHEBI:5957) is a hydrate (CHEBI:35505) |
| IUPAC Name |
|---|
| (3-endo,8-syn)-3-[(3-hydroxy-2-phenylpropanoyl)oxy]-8-isopropyl-8-methyl-8-azoniabicyclo[3.2.1]octane bromide—water (1/1) |
| Synonyms | Source |
|---|---|
| ipratropium bromide | ChemIDplus |
| ipratropium bromide hydrate | ChemIDplus |
| ipratropium bromide monohydrate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:66985-17-9 | ChemIDplus |