EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Br.C20H30NO3 |
| Net Charge | 0 |
| Average Mass | 412.368 |
| Monoisotopic Mass | 411.14091 |
| SMILES | [Br-].[H][C@]12CC[C@]([H])(C[C@H](OC(=O)C(CO)c3ccccc3)C1)[N@+]2(C)C(C)C |
| InChI | InChI=1S/C20H30NO3.BrH/c1-14(2)21(3)16-9-10-17(21)12-18(11-16)24-20(23)19(13-22)15-7-5-4-6-8-15;/h4-8,14,16-19,22H,9-13H2,1-3H3;1H/q+1;/p-1/t16-,17+,18+,19?,21+; |
| InChIKey | LHLMOSXCXGLMMN-VVQPYUEFSA-M |
| Roles Classification |
|---|
| Biological Role: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. bronchodilator agent An agent that causes an increase in the expansion of a bronchus or bronchial tubes. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ipratropium bromide (CHEBI:46659) has part ipratropium (CHEBI:5956) |
| ipratropium bromide (CHEBI:46659) has role antispasmodic drug (CHEBI:53784) |
| ipratropium bromide (CHEBI:46659) has role bronchodilator agent (CHEBI:35523) |
| ipratropium bromide (CHEBI:46659) has role muscarinic antagonist (CHEBI:48876) |
| ipratropium bromide (CHEBI:46659) is a organic bromide salt (CHEBI:48369) |
| Incoming Relation(s) |
| ipratropium bromide hydrate (CHEBI:5957) has part ipratropium bromide (CHEBI:46659) |
| IUPAC Name |
|---|
| (3-endo,8-syn)-3-[(3-hydroxy-2-phenylpropanoyl)oxy]-8-isopropyl-8-methyl-8-azoniabicyclo[3.2.1]octane bromide |
| INNs | Source |
|---|---|
| bromure d'ipratropium | ChemIDplus |
| bromuro de ipratropio | ChemIDplus |
| ipratropii bromidum | ChemIDplus |
| ipratropium bromide | ChemIDplus |
| Synonyms | Source |
|---|---|
| 3α-hydroxy-8-isopropyl-1αH,5αH-tropanium bromide (±)-tropate | ChEBI |
| 8-isopropylnoratropine methobromide | ChemIDplus |
| N-isopropylnoratropinium bromomethylate | ChemIDplus |
| (endo,syn)-(±)-3-(3-hydroxy-1-oxo-2-phenylpropoxy)-8-methyl-8-(1-methylethyl)-8-azoniabicyclo[3.2.1]octane bromide | ChEBI |
| Ipratropiumbromid | ChemIDplus |
| ipratropium bromide (anhydrous) | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:10404264 | Beilstein |
| CAS:22254-24-6 | ChemIDplus |