EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Br.C20H30NO3 |
| Net Charge | 0 |
| Average Mass | 412.368 |
| Monoisotopic Mass | 411.14091 |
| SMILES | [Br-].[H][C@]12CC[C@]([H])(C[C@H](OC(=O)C(CO)c3ccccc3)C1)[N@+]2(C)C(C)C |
| InChI | InChI=1S/C20H30NO3.BrH/c1-14(2)21(3)16-9-10-17(21)12-18(11-16)24-20(23)19(13-22)15-7-5-4-6-8-15;/h4-8,14,16-19,22H,9-13H2,1-3H3;1H/q+1;/p-1/t16-,17+,18+,19?,21+; |
| InChIKey | LHLMOSXCXGLMMN-VVQPYUEFSA-M |
| Roles Classification |
|---|
| Biological Role: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | bronchodilator agent An agent that causes an increase in the expansion of a bronchus or bronchial tubes. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ipratropium bromide (CHEBI:46659) has part ipratropium (CHEBI:5956) |
| ipratropium bromide (CHEBI:46659) has role antispasmodic drug (CHEBI:53784) |
| ipratropium bromide (CHEBI:46659) has role bronchodilator agent (CHEBI:35523) |
| ipratropium bromide (CHEBI:46659) has role muscarinic antagonist (CHEBI:48876) |
| ipratropium bromide (CHEBI:46659) is a organic bromide salt (CHEBI:48369) |
| Incoming Relation(s) |
| ipratropium bromide hydrate (CHEBI:5957) has part ipratropium bromide (CHEBI:46659) |
| IUPAC Name |
|---|
| (3-endo,8-syn)-3-[(3-hydroxy-2-phenylpropanoyl)oxy]-8-isopropyl-8-methyl-8-azoniabicyclo[3.2.1]octane bromide |
| INNs | Source |
|---|---|
| bromure d'ipratropium | ChemIDplus |
| bromuro de ipratropio | ChemIDplus |
| ipratropii bromidum | ChemIDplus |
| ipratropium bromide | ChemIDplus |
| Synonyms | Source |
|---|---|
| 3α-hydroxy-8-isopropyl-1αH,5αH-tropanium bromide (±)-tropate | ChEBI |
| 8-isopropylnoratropine methobromide | ChemIDplus |
| N-isopropylnoratropinium bromomethylate | ChemIDplus |
| (endo,syn)-(±)-3-(3-hydroxy-1-oxo-2-phenylpropoxy)-8-methyl-8-(1-methylethyl)-8-azoniabicyclo[3.2.1]octane bromide | ChEBI |
| Ipratropiumbromid | ChemIDplus |
| ipratropium bromide (anhydrous) | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:10404264 | Beilstein |
| CAS:22254-24-6 | ChemIDplus |