EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:59569 - (R)-clenbuterol hydrochloride
| Formula | C12H18Cl2N2O.HCl |
| Net Charge | 0 |
| Average Mass | 313.656 |
| Monoisotopic Mass | 312.05630 |
| SMILES | CC(C)(C)NC[C@H](O)c1cc(Cl)c(N)c(Cl)c1.Cl |
| InChI | InChI=1S/C12H18Cl2N2O.ClH/c1-12(2,3)16-6-10(17)7-4-8(13)11(15)9(14)5-7;/h4-5,10,16-17H,6,15H2,1-3H3;1H/t10-;/m0./s1 |
| InChIKey | OPXKTCUYRHXSBK-PPHPATTJSA-N |
| Roles Classification |
|---|
| Biological Roles: | beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. |
| Applications: | beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. bronchodilator agent An agent that causes an increase in the expansion of a bronchus or bronchial tubes. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-clenbuterol hydrochloride (CHEBI:59569) is a clenbuterol hydrochloride (CHEBI:31410) |
| (R)-clenbuterol hydrochloride (CHEBI:59569) is enantiomer of (S)-clenbuterol hydrochloride (CHEBI:59570) |
| Incoming Relation(s) |
| (S)-clenbuterol hydrochloride (CHEBI:59570) is enantiomer of (R)-clenbuterol hydrochloride (CHEBI:59569) |
| IUPAC Name |
|---|
| (1R)-1-(4-amino-3,5-dichlorophenyl)-2-(tert-butylamino)ethanol hydrochloride |
| Synonyms | Source |
|---|---|
| (R)-(−)-clenbuterol hydrochloride | ChEBI |
| (−)-clenbuterol hydrochloride | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:9368591 | Beilstein |