EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H18Cl2N2O.HCl |
| Net Charge | 0 |
| Average Mass | 313.656 |
| Monoisotopic Mass | 312.05630 |
| SMILES | CC(C)(C)NCC(O)c1cc(Cl)c(N)c(Cl)c1.Cl |
| InChI | InChI=1S/C12H18Cl2N2O.ClH/c1-12(2,3)16-6-10(17)7-4-8(13)11(15)9(14)5-7;/h4-5,10,16-17H,6,15H2,1-3H3;1H |
| InChIKey | OPXKTCUYRHXSBK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. |
| Applications: | bronchodilator agent An agent that causes an increase in the expansion of a bronchus or bronchial tubes. beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clenbuterol hydrochloride (CHEBI:31410) has part clenbuterol(1+) (CHEBI:61153) |
| clenbuterol hydrochloride (CHEBI:31410) has role bronchodilator agent (CHEBI:35523) |
| clenbuterol hydrochloride (CHEBI:31410) has role sympathomimetic agent (CHEBI:35524) |
| clenbuterol hydrochloride (CHEBI:31410) has role β-adrenergic agonist (CHEBI:35522) |
| clenbuterol hydrochloride (CHEBI:31410) is a hydrochloride (CHEBI:36807) |
| Incoming Relation(s) |
| (R)-clenbuterol hydrochloride (CHEBI:59569) is a clenbuterol hydrochloride (CHEBI:31410) |
| (S)-clenbuterol hydrochloride (CHEBI:59570) is a clenbuterol hydrochloride (CHEBI:31410) |
| IUPAC Name |
|---|
| 1-(4-amino-3,5-dichlorophenyl)-2-(tert-butylamino)ethanol hydrochloride |
| Synonyms | Source |
|---|---|
| 4-amino-3,5-dichloro-α-(((1,1-dimethylethyl)amino)methyl)benzenemethanol hydrochloride | ChEBI |
| 4-amino-3,5-dichloro-α-(((1,1-dimethylethyl)amino)methyl)benzenemethanol monohydrochloride | ChEBI |
| 4-amino-α-((tert-butylamino)methyl)-3,5-dichlorobenzyl alcohol hydrochloride | ChemIDplus |
| 4-amino-α-((tert-butylamino)methyl)-3,5-dichlorobenzyl alcohol monohydrochloride | ChEBI |
| clenbuterol clorhidrato | ChemIDplus |
| clenbuterol HCl | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D01360 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5780956 | Beilstein |
| CAS:21898-19-1 | KEGG DRUG |