EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H38N6O21P |
| Net Charge | -5 |
| Average Mass | 897.673 |
| Monoisotopic Mass | 897.18551 |
| SMILES | C[C@H](OP(=O)([O-])OC[C@@H](O)[C@@H](O)[C@@H](O)Cn1c2nc(=O)nc(=O)c-2cc2ccc(O)cc21)C(=O)N[C@@H](CCC(=O)N[C@@H](CCC(=O)N[C@@H](CCC(=O)[O-])C(=O)[O-])C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C34H43N6O21P/c1-14(29(49)37-20(33(55)56)5-8-25(45)35-18(31(51)52)4-7-24(44)36-19(32(53)54)6-9-26(46)47)61-62(58,59)60-13-23(43)27(48)22(42)12-40-21-11-16(41)3-2-15(21)10-17-28(40)38-34(57)39-30(17)50/h2-3,10-11,14,18-20,22-23,27,41-43,48H,4-9,12-13H2,1H3,(H,35,45)(H,36,44)(H,37,49)(H,46,47)(H,51,52)(H,53,54)(H,55,56)(H,58,59)(H,39,50,57)/p-5/t14-,18-,19-,20-,22-,23+,27-/m0/s1 |
| InChIKey | YHDAXCLOUDHUAA-LROHGRLLSA-I |
| Roles Classification |
|---|
| Biological Role: | coenzyme A low-molecular-weight, non-protein organic compound participating in enzymatic reactions as dissociable acceptor or donor of chemical groups or electrons. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| coenzyme α-F420-3(5−) (CHEBI:59539) has role coenzyme (CHEBI:23354) |
| coenzyme α-F420-3(5−) (CHEBI:59539) is a dialkyl phosphate anion (CHEBI:58944) |
| coenzyme α-F420-3(5−) (CHEBI:59539) is a pyrimidoquinolines (CHEBI:59535) |
| coenzyme α-F420-3(5−) (CHEBI:59539) is a ribitol phosphate (CHEBI:26554) |
| coenzyme α-F420-3(5−) (CHEBI:59539) is a tetracarboxylic acid anion (CHEBI:35754) |
| coenzyme α-F420-3(5−) (CHEBI:59539) is conjugate acid of coenzyme α-F420-3(6−) (CHEBI:59923) |
| coenzyme α-F420-3(5−) (CHEBI:59539) is conjugate base of coenzyme α-F420-3 (CHEBI:59537) |
| Incoming Relation(s) |
| coenzyme α-F420-3 (CHEBI:59537) is conjugate acid of coenzyme α-F420-3(5−) (CHEBI:59539) |
| coenzyme α-F420-3(6−) (CHEBI:59923) is conjugate base of coenzyme α-F420-3(5−) (CHEBI:59539) |
| Synonyms | Source |
|---|---|
| coenzyme α-F420-3 penta-anion | ChEBI |
| α-F420-3(5−) | ChEBI |
| α-F420-3 penta-anion | ChEBI |
| Citations |
|---|