EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:59477 - chloroxine
| Formula | C9H5Cl2NO |
| Net Charge | 0 |
| Average Mass | 214.051 |
| Monoisotopic Mass | 212.97482 |
| SMILES | Oc1c(Cl)cc(Cl)c2cccnc12 |
| InChI | InChI=1S/C9H5Cl2NO/c10-6-4-7(11)9(13)8-5(6)2-1-3-12-8/h1-4,13H |
| InChIKey | WDFKMLRRRCGAKS-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| Applications: | antiseborrheic A drug or agent applied to the skin to control seborrhea or seborrheic dermatitis. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chloroxine (CHEBI:59477) has functional parent quinolin-8-ol (CHEBI:48981) |
| chloroxine (CHEBI:59477) has role antibacterial agent (CHEBI:33282) |
| chloroxine (CHEBI:59477) has role antifungal drug (CHEBI:86327) |
| chloroxine (CHEBI:59477) has role antiseborrheic (CHEBI:59010) |
| chloroxine (CHEBI:59477) is a monohydroxyquinoline (CHEBI:38775) |
| chloroxine (CHEBI:59477) is a organochlorine compound (CHEBI:36683) |
| IUPAC Name |
|---|
| 5,7-dichloroquinolin-8-ol |
| Synonyms | Source |
|---|---|
| 5,7-dichloro-8-quinolinol | NIST Chemistry WebBook |
| 5,7-dichlor-8-hydroxychinolin | ChemIDplus |
| 5,7-dichloro-8-oxyquinoline | NIST Chemistry WebBook |
| 5,7-dichloroxine | NIST Chemistry WebBook |
| 5,7-dichlorooxine | ChemIDplus |
| 5,7-dichloro-8-hydroxyquinoline | ChemIDplus |
| Citations |
|---|