EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H7NO |
| Net Charge | 0 |
| Average Mass | 145.161 |
| Monoisotopic Mass | 145.05276 |
| SMILES | Oc1cccc2cccnc12 |
| InChI | InChI=1S/C9H7NO/c11-8-5-1-3-7-4-2-6-10-9(7)8/h1-6,11H |
| InChIKey | MCJGNVYPOGVAJF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | |
| Biological Roles: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Applications: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. antiseptic drug A substance used locally on humans and other animals to destroy harmful microorganisms or to inhibit their activity (cf. disinfectants, which destroy microorganisms found on non-living objects, and antibiotics, which can be transported through the lymphatic system to destroy bacteria within the body). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| quinolin-8-ol (CHEBI:48981) has parent hydride quinoline (CHEBI:17362) |
| quinolin-8-ol (CHEBI:48981) has role antibacterial agent (CHEBI:33282) |
| quinolin-8-ol (CHEBI:48981) has role antifungal agrochemical (CHEBI:86328) |
| quinolin-8-ol (CHEBI:48981) has role antiinfective agent (CHEBI:35441) |
| quinolin-8-ol (CHEBI:48981) has role antiseptic drug (CHEBI:48218) |
| quinolin-8-ol (CHEBI:48981) has role iron chelator (CHEBI:38157) |
| quinolin-8-ol (CHEBI:48981) is a monohydroxyquinoline (CHEBI:38775) |
| Incoming Relation(s) |
| 8-hydroxyquinoline N-oxide (CHEBI:192375) has functional parent quinolin-8-ol (CHEBI:48981) |
| chloroxine (CHEBI:59477) has functional parent quinolin-8-ol (CHEBI:48981) |
| IUPAC Name |
|---|
| quinolin-8-ol |
| Synonyms | Source |
|---|---|
| 1-Azanaphthalene-8-ol | ChemIDplus |
| 8-Chinolinol | ChEBI |
| 8-Hydroxy-chinolin | ChemIDplus |
| 8-Hydroxyquinoline | ChemIDplus |
| 8-OQ | ChemIDplus |
| 8-Quinol | ChemIDplus |
| UniProt Name | Source |
|---|---|
| quinolin-8-ol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 1354 | PPDB |
| 3290 | DrugCentral |
| 8-Hydroxyquinoline | Wikipedia |
| 8-HYDROXYQUINOLINE | MetaCyc |
| C19434 | KEGG COMPOUND |
| D05321 | KEGG DRUG |
| HQY | PDBeChem |
| Citations |
|---|