EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H7NO |
| Net Charge | 0 |
| Average Mass | 145.161 |
| Monoisotopic Mass | 145.05276 |
| SMILES | Oc1cccc2cccnc12 |
| InChI | InChI=1S/C9H7NO/c11-8-5-1-3-7-4-2-6-10-9(7)8/h1-6,11H |
| InChIKey | MCJGNVYPOGVAJF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. |
| Applications: | antiseptic drug A substance used locally on humans and other animals to destroy harmful microorganisms or to inhibit their activity (cf. disinfectants, which destroy microorganisms found on non-living objects, and antibiotics, which can be transported through the lymphatic system to destroy bacteria within the body). antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| quinolin-8-ol (CHEBI:48981) has parent hydride quinoline (CHEBI:17362) |
| quinolin-8-ol (CHEBI:48981) has role antibacterial agent (CHEBI:33282) |
| quinolin-8-ol (CHEBI:48981) has role antifungal agrochemical (CHEBI:86328) |
| quinolin-8-ol (CHEBI:48981) has role antiseptic drug (CHEBI:48218) |
| quinolin-8-ol (CHEBI:48981) has role iron chelator (CHEBI:38157) |
| quinolin-8-ol (CHEBI:48981) is a monohydroxyquinoline (CHEBI:38775) |
| Incoming Relation(s) |
| 8-hydroxyquinoline N-oxide (CHEBI:192375) has functional parent quinolin-8-ol (CHEBI:48981) |
| chloroxine (CHEBI:59477) has functional parent quinolin-8-ol (CHEBI:48981) |
| IUPAC Name |
|---|
| quinolin-8-ol |
| Synonyms | Source |
|---|---|
| 1-Azanaphthalene-8-ol | ChemIDplus |
| 8-Chinolinol | ChEBI |
| 8-Hydroxy-chinolin | ChemIDplus |
| 8-Hydroxyquinoline | ChemIDplus |
| 8-OQ | ChemIDplus |
| 8-Quinol | ChemIDplus |
| UniProt Name | Source |
|---|---|
| quinolin-8-ol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 1354 | PPDB |
| 3290 | DrugCentral |
| 8-Hydroxyquinoline | Wikipedia |
| 8-HYDROXYQUINOLINE | MetaCyc |
| C19434 | KEGG COMPOUND |
| D05321 | KEGG DRUG |
| HQY | PDBeChem |
| Citations |
|---|