EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H9ClO |
| Net Charge | 0 |
| Average Mass | 305.535 |
| Monoisotopic Mass | 305.00141 |
| SMILES | COC(C)[CH2][197Hg][Cl] |
| InChI | InChI=1S/C4H9O.ClH.Hg/c1-4(2)5-3;;/h4H,1H2,2-3H3;1H;/q;;+1/p-1/i;;1-4 |
| InChIKey | XVUKSLOWICFXTO-WUYZZQIKSA-M |
| Roles Classification |
|---|
| Applications: | diagnostic agent A substance administered to aid diagnosis of a disease. diuretic An agent that promotes the excretion of urine through its effects on kidney function. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlormerodrin (197Hg) (CHEBI:59455) has role radioactive imaging agent (CHEBI:37336) |
| chlormerodrin (197Hg) (CHEBI:59455) is a chlormerodrin (CHEBI:59445) |
| chlormerodrin (197Hg) (CHEBI:59455) is a isotopically modified compound (CHEBI:139358) |
| IUPAC Name |
|---|
| [3-(carbamoylamino)-2-methoxypropyl](chloro)(197Hg)mercury |
| INN | Source |
|---|---|
| chlormerodrin (197Hg) | KEGG DRUG |
| Synonyms | Source |
|---|---|
| 3-ureido-2-methoxypropyl(197Hg)mercury(II) chloride | ChEBI |
| chlormerodrin Hg 197 | KEGG DRUG |
| chloro(2-methoxy-3-ureidopropyl)(197Hg)mercury(II) | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:10375-56-1 | KEGG DRUG |
| CAS:10375-56-1 | ChemIDplus |