EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H11ClHgN2O2 |
| Net Charge | 0 |
| Average Mass | 367.198 |
| Monoisotopic Mass | 368.02155 |
| SMILES | COC(CNC(N)=O)[CH2][Hg][Cl] |
| InChI | InChI=1S/C5H11N2O2.ClH.Hg/c1-4(9-2)3-7-5(6)8;;/h4H,1,3H2,2H3,(H3,6,7,8);1H;/q;;+1/p-1 |
| InChIKey | BJFGVYCULWBXKF-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Applications: | diagnostic agent A substance administered to aid diagnosis of a disease. diuretic An agent that promotes the excretion of urine through its effects on kidney function. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlormerodrin (CHEBI:59445) has role diagnostic agent (CHEBI:33295) |
| chlormerodrin (CHEBI:59445) has role diuretic (CHEBI:35498) |
| chlormerodrin (CHEBI:59445) is a organomercury compound (CHEBI:25706) |
| chlormerodrin (CHEBI:59445) is a ureas (CHEBI:47857) |
| Incoming Relation(s) |
| chlormerodrin (197Hg) (CHEBI:59455) is a chlormerodrin (CHEBI:59445) |
| chlormerodrin (203Hg) (CHEBI:59462) is a chlormerodrin (CHEBI:59445) |
| IUPAC Name |
|---|
| [3-(carbamoylamino)-2-methoxypropyl](chloro)mercury |
| INNs | Source |
|---|---|
| chlormerodrin | ChemIDplus |
| chlormerodrina | ChemIDplus |
| chlormerodrine | ChemIDplus |
| chlormerodrinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-[3-(chloromercuri)-2-methoxypropyl]urea | ChemIDplus |
| {3-[(aminocarbonyl)amino]-2-methoxypropyl}chloromercury | ChemIDplus |