EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H25N6O5S2 |
| Net Charge | +1 |
| Average Mass | 481.580 |
| Monoisotopic Mass | 481.13224 |
| SMILES | [H][C@]12SCC(C[N+]3(C)CCCC3)=C(C(=O)O)N1C(=O)[C@H]2NC(=O)/C(=N\OC)c1csc(N)n1 |
| InChI | InChI=1S/C19H24N6O5S2/c1-25(5-3-4-6-25)7-10-8-31-17-13(16(27)24(17)14(10)18(28)29)22-15(26)12(23-30-2)11-9-32-19(20)21-11/h9,13,17H,3-8H2,1-2H3,(H3-,20,21,22,26,28,29)/p+1/b23-12-/t13-,17-/m1/s1 |
| InChIKey | HVFLCNVBZFFHBT-ZKDACBOMSA-O |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefepime(1+) (CHEBI:59349) is a cephalosporin (CHEBI:23066) |
| cefepime(1+) (CHEBI:59349) is conjugate acid of cefepime (CHEBI:478164) |
| Incoming Relation(s) |
| cefepime hydrochloride (CHEBI:31368) has part cefepime(1+) (CHEBI:59349) |
| cefepime (CHEBI:478164) is conjugate base of cefepime(1+) (CHEBI:59349) |
| IUPAC Names |
|---|
| 1-{[(6R,7R)-7-{[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetyl]amino}-2-carboxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl}-1-methylpyrrolidinium |
| 7β-[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetamido]-3-[(1-methylpyrrolidinium-1-yl)methyl]-3,4-didehydrocepham-4-carboxylic acid |
| Synonym | Source |
|---|---|
| cefepime conjugate acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5196242 | Beilstein |