EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24N6O5S2 |
| Net Charge | 0 |
| Average Mass | 480.572 |
| Monoisotopic Mass | 480.12496 |
| SMILES | [H][C@]12SCC(C[N+]3(C)CCCC3)=C(C(=O)[O-])N1C(=O)[C@H]2NC(=O)/C(=N\OC)c1csc(N)n1 |
| InChI | InChI=1S/C19H24N6O5S2/c1-25(5-3-4-6-25)7-10-8-31-17-13(16(27)24(17)14(10)18(28)29)22-15(26)12(23-30-2)11-9-32-19(20)21-11/h9,13,17H,3-8H2,1-2H3,(H3-,20,21,22,26,28,29)/b23-12-/t13-,17-/m1/s1 |
| InChIKey | HVFLCNVBZFFHBT-ZKDACBOMSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. antibacterial drug A drug used to treat or prevent bacterial infections. renoprotective agent Any compound that is able to prevent damage to the kidneys. drug allergen Any drug which causes the onset of an allergic reaction. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefepime (CHEBI:478164) has role antibacterial agent (CHEBI:33282) |
| cefepime (CHEBI:478164) has role antibacterial drug (CHEBI:36047) |
| cefepime (CHEBI:478164) has role antiinfective agent (CHEBI:35441) |
| cefepime (CHEBI:478164) has role antineoplastic agent (CHEBI:35610) |
| cefepime (CHEBI:478164) has role renoprotective agent (CHEBI:231911) |
| cefepime (CHEBI:478164) is a cephalosporin (CHEBI:23066) |
| cefepime (CHEBI:478164) is a oxime O-ether (CHEBI:36816) |
| cefepime (CHEBI:478164) is conjugate base of cefepime(1+) (CHEBI:59349) |
| Incoming Relation(s) |
| cefepime(1+) (CHEBI:59349) is conjugate acid of cefepime (CHEBI:478164) |
| IUPAC Name |
|---|
| 7β-[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetamido]-3-[(1-methylpyrrolidinium-1-yl)methyl]-3,4-didehydrocepham-4-carboxylate |
| INNs | Source |
|---|---|
| cefepima | ChemIDplus |
| cefepime | ChemIDplus |
| cefepimum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (6R,7R)-7-{[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetyl]amino}-3-[(1-methylpyrrolidinium-1-yl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate | IUPAC |
| BMY-28142 | ChEMBL |
| cefepime | ChEMBL |
| Cefepime | KEGG COMPOUND |
| CFPM | ChEBI |
| J01DE01 | ChEMBL |
| Brand Name | Source |
|---|---|
| Renapime | ChEMBL |
| Citations |
|---|