EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H21BrNO.Cl |
| Net Charge | 0 |
| Average Mass | 370.718 |
| Monoisotopic Mass | 369.04950 |
| SMILES | C[NH+](C)CCO[C@H](c1ccccc1)c1ccc(Br)cc1.[Cl-] |
| InChI | InChI=1S/C17H20BrNO.ClH/c1-19(2)12-13-20-17(14-6-4-3-5-7-14)15-8-10-16(18)11-9-15;/h3-11,17H,12-13H2,1-2H3;1H/t17-;/m1./s1 |
| InChIKey | ZQDJSWUEGOYDGT-UNTBIKODSA-N |
| Roles Classification |
|---|
| Biological Roles: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-bromazine hydrochloride (CHEBI:59304) is a bromazine hydrochloride (CHEBI:59178) |
| (R)-bromazine hydrochloride (CHEBI:59304) is enantiomer of (S)-bromazine hydrochloride (CHEBI:59305) |
| Incoming Relation(s) |
| (S)-bromazine hydrochloride (CHEBI:59305) is enantiomer of (R)-bromazine hydrochloride (CHEBI:59304) |
| IUPAC Name |
|---|
| 2-[(R)-(4-bromophenyl)(phenyl)methoxy]-N,N-dimethylethanamine hydrochloride |
| Synonyms | Source |
|---|---|
| 2-[(R)-(4-bromophenyl)(phenyl)methoxy]-N,N-dimethylethanaminium chloride | IUPAC |
| (R)-bromazine HCl | ChEBI |
| (R)-bromodiphenhydramine HCl | ChEBI |
| (R)-bromodiphenhydramine hydrochloride | ChEBI |
| (R)-β-(p-bromobenzhydryloxy)ethyldimethylamine hydrochloride | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| DB01237 | DrugBank |