EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:59178 - bromazine hydrochloride
| Formula | C17H21BrNO.Cl |
| Net Charge | 0 |
| Average Mass | 370.718 |
| Monoisotopic Mass | 369.04950 |
| SMILES | C[NH+](C)CCOC(c1ccccc1)c1ccc(Br)cc1.[Cl-] |
| InChI | InChI=1S/C17H20BrNO.ClH/c1-19(2)12-13-20-17(14-6-4-3-5-7-14)15-8-10-16(18)11-9-15;/h3-11,17H,12-13H2,1-2H3;1H |
| InChIKey | ZQDJSWUEGOYDGT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| Applications: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bromazine hydrochloride (CHEBI:59178) has role antimicrobial agent (CHEBI:33281) |
| bromazine hydrochloride (CHEBI:59178) has role H1-receptor antagonist (CHEBI:37955) |
| bromazine hydrochloride (CHEBI:59178) has role histamine antagonist (CHEBI:37956) |
| bromazine hydrochloride (CHEBI:59178) has role muscarinic antagonist (CHEBI:48876) |
| bromazine hydrochloride (CHEBI:59178) is a hydrochloride (CHEBI:36807) |
| bromazine hydrochloride (CHEBI:59178) is a organobromine compound (CHEBI:37141) |
| Incoming Relation(s) |
| bromazine (CHEBI:59177) has part bromazine hydrochloride (CHEBI:59178) |
| (R)-bromazine hydrochloride (CHEBI:59304) is a bromazine hydrochloride (CHEBI:59178) |
| (S)-bromazine hydrochloride (CHEBI:59305) is a bromazine hydrochloride (CHEBI:59178) |
| IUPAC Name |
|---|
| 2-[(4-bromophenyl)(phenyl)methoxy]-N,N-dimethylethanamine hydrochloride |
| Synonyms | Source |
|---|---|
| 2-[(4-bromophenyl)(phenyl)methoxy]-N,N-dimethylethanamine hydrochloride (1:1) | IUPAC |
| 2-[(4-bromophenyl)(phenyl)methoxy]-N,N-dimethylethanaminium chloride | IUPAC |
| 2-(p-bromo-α-phenylbenzyloxy)-N,N-dimethylethylamine hydrochloride | ChEBI |
| bromazine HCl | ChEBI |
| bromodiphenhydramine HCl | ChemIDplus |
| bromodiphenhydramine hydrochloride | ChemIDplus |