EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:59178 - bromazine hydrochloride
| Formula | C17H21BrNO.Cl |
| Net Charge | 0 |
| Average Mass | 370.718 |
| Monoisotopic Mass | 369.04950 |
| SMILES | C[NH+](C)CCOC(c1ccccc1)c1ccc(Br)cc1.[Cl-] |
| InChI | InChI=1S/C17H20BrNO.ClH/c1-19(2)12-13-20-17(14-6-4-3-5-7-14)15-8-10-16(18)11-9-15;/h3-11,17H,12-13H2,1-2H3;1H |
| InChIKey | ZQDJSWUEGOYDGT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| Applications: | histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bromazine hydrochloride (CHEBI:59178) has role antimicrobial agent (CHEBI:33281) |
| bromazine hydrochloride (CHEBI:59178) has role H1-receptor antagonist (CHEBI:37955) |
| bromazine hydrochloride (CHEBI:59178) has role histamine antagonist (CHEBI:37956) |
| bromazine hydrochloride (CHEBI:59178) has role muscarinic antagonist (CHEBI:48876) |
| bromazine hydrochloride (CHEBI:59178) is a hydrochloride (CHEBI:36807) |
| bromazine hydrochloride (CHEBI:59178) is a organobromine compound (CHEBI:37141) |
| Incoming Relation(s) |
| bromazine (CHEBI:59177) has part bromazine hydrochloride (CHEBI:59178) |
| (R)-bromazine hydrochloride (CHEBI:59304) is a bromazine hydrochloride (CHEBI:59178) |
| (S)-bromazine hydrochloride (CHEBI:59305) is a bromazine hydrochloride (CHEBI:59178) |
| IUPAC Name |
|---|
| 2-[(4-bromophenyl)(phenyl)methoxy]-N,N-dimethylethanamine hydrochloride |
| Synonyms | Source |
|---|---|
| 2-[(4-bromophenyl)(phenyl)methoxy]-N,N-dimethylethanamine hydrochloride (1:1) | IUPAC |
| 2-[(4-bromophenyl)(phenyl)methoxy]-N,N-dimethylethanaminium chloride | IUPAC |
| 2-(p-bromo-α-phenylbenzyloxy)-N,N-dimethylethylamine hydrochloride | ChEBI |
| bromazine HCl | ChEBI |
| bromodiphenhydramine HCl | ChemIDplus |
| bromodiphenhydramine hydrochloride | ChemIDplus |