EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14F3N3O4S2 |
| Net Charge | 0 |
| Average Mass | 421.422 |
| Monoisotopic Mass | 421.03778 |
| SMILES | NS(=O)(=O)c1cc2c(cc1C(F)(F)F)N[C@H](Cc1ccccc1)NS2(=O)=O |
| InChI | InChI=1S/C15H14F3N3O4S2/c16-15(17,18)10-7-11-13(8-12(10)26(19,22)23)27(24,25)21-14(20-11)6-9-4-2-1-3-5-9/h1-5,7-8,14,20-21H,6H2,(H2,19,22,23)/t14-/m0/s1 |
| InChIKey | HDWIHXWEUNVBIY-AWEZNQCLSA-N |
| Roles Classification |
|---|
| Applications: | diuretic An agent that promotes the excretion of urine through its effects on kidney function. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-bendroflumethiazide (CHEBI:59244) is a bendroflumethiazide (CHEBI:3013) |
| (S)-bendroflumethiazide (CHEBI:59244) is enantiomer of (R)-bendroflumethiazide (CHEBI:59243) |
| Incoming Relation(s) |
| (R)-bendroflumethiazide (CHEBI:59243) is enantiomer of (S)-bendroflumethiazide (CHEBI:59244) |
| Manual Xrefs | Databases |
|---|---|
| DB00436 | DrugBank |