EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14F3N3O4S2 |
| Net Charge | 0 |
| Average Mass | 421.422 |
| Monoisotopic Mass | 421.03778 |
| SMILES | NS(=O)(=O)c1cc2c(cc1C(F)(F)F)N[C@H](Cc1ccccc1)NS2(=O)=O |
| InChI | InChI=1S/C15H14F3N3O4S2/c16-15(17,18)10-7-11-13(8-12(10)26(19,22)23)27(24,25)21-14(20-11)6-9-4-2-1-3-5-9/h1-5,7-8,14,20-21H,6H2,(H2,19,22,23)/t14-/m0/s1 |
| InChIKey | HDWIHXWEUNVBIY-AWEZNQCLSA-N |
| Roles Classification |
|---|
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. diuretic An agent that promotes the excretion of urine through its effects on kidney function. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-bendroflumethiazide (CHEBI:59244) is a bendroflumethiazide (CHEBI:3013) |
| (S)-bendroflumethiazide (CHEBI:59244) is enantiomer of (R)-bendroflumethiazide (CHEBI:59243) |
| Incoming Relation(s) |
| (R)-bendroflumethiazide (CHEBI:59243) is enantiomer of (S)-bendroflumethiazide (CHEBI:59244) |
| Manual Xrefs | Databases |
|---|---|
| DB00436 | DrugBank |