EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14F3N3O4S2 |
| Net Charge | 0 |
| Average Mass | 421.422 |
| Monoisotopic Mass | 421.03778 |
| SMILES | NS(=O)(=O)c1cc2c(cc1C(F)(F)F)NC(Cc1ccccc1)NS2(=O)=O |
| InChI | InChI=1S/C15H14F3N3O4S2/c16-15(17,18)10-7-11-13(8-12(10)26(19,22)23)27(24,25)21-14(20-11)6-9-4-2-1-3-5-9/h1-5,7-8,14,20-21H,6H2,(H2,19,22,23) |
| InChIKey | HDWIHXWEUNVBIY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. diuretic An agent that promotes the excretion of urine through its effects on kidney function. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bendroflumethiazide (CHEBI:3013) has role antihypertensive agent (CHEBI:35674) |
| bendroflumethiazide (CHEBI:3013) has role cardiovascular drug (CHEBI:35554) |
| bendroflumethiazide (CHEBI:3013) has role diuretic (CHEBI:35498) |
| bendroflumethiazide (CHEBI:3013) is a benzothiadiazine (CHEBI:50265) |
| bendroflumethiazide (CHEBI:3013) is a sulfonamide (CHEBI:35358) |
| Incoming Relation(s) |
| (R)-bendroflumethiazide (CHEBI:59243) is a bendroflumethiazide (CHEBI:3013) |
| (S)-bendroflumethiazide (CHEBI:59244) is a bendroflumethiazide (CHEBI:3013) |
| IUPAC Name |
|---|
| 3-benzyl-6-(trifluoromethyl)-3,4-dihydro-2H-1,2,4-benzothiadiazine-7-sulfonamide 1,1-dioxide |
| INNs | Source |
|---|---|
| bendroflumethiazide | KEGG DRUG |
| bendroflumethiazidum | ChemIDplus |
| bendroflumetiazida | ChemIDplus |
| Synonyms | Source |
|---|---|
| ±-3-benzyl-3,4-dihydro-6-(trifluoromethyl)-2H-1,2,4-benzothiadiazine-7-sulfonamide 1,1-dioxide | ChemIDplus |
| 6-trifluoromethyl-3-benzyl-7-sulfamyl-3,4-dihydro-1,2,4-benzothiadiazine 1,1-dioxide | ChemIDplus |
| bendrofluazide | ChemIDplus |
| Bendroflumethiazide | KEGG COMPOUND |
| benzhydroflumethiazide | ChemIDplus |
| NSC-758229 | ChEMBL |
| Brand Names | Source |
|---|---|
| Aprinox | ChEMBL |
| Bendroflumethiazide component of corzide | ChEMBL |
| Berkozide | ChEMBL |
| Centyl | ChEMBL |
| Naturetin | ChEMBL |
| Naturetin-10 | ChEMBL |
| Citations |
|---|