EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12O12 |
| Net Charge | -6 |
| Average Mass | 336.120 |
| Monoisotopic Mass | 335.94227 |
| SMILES | O=C([O-])c1c(C(=O)[O-])c(C(=O)[O-])c(C(=O)[O-])c(C(=O)[O-])c1C(=O)[O-] |
| InChI | InChI=1S/C12H6O12/c13-7(14)1-2(8(15)16)4(10(19)20)6(12(23)24)5(11(21)22)3(1)9(17)18/h(H,13,14)(H,15,16)(H,17,18)(H,19,20)(H,21,22)(H,23,24)/p-6 |
| InChIKey | YDSWCNNOKPMOTP-UHFFFAOYSA-H |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mellitic acid hexaanion (CHEBI:59227) is a hexacarboxylic acid anion (CHEBI:59360) |
| mellitic acid hexaanion (CHEBI:59227) is conjugate base of mellitic acid (CHEBI:41089) |
| Incoming Relation(s) |
| mellitic acid (CHEBI:41089) is conjugate acid of mellitic acid hexaanion (CHEBI:59227) |
| IUPAC Name |
|---|
| benzene-1,2,3,4,5,6-hexacarboxylate |
| Synonyms | Source |
|---|---|
| mellitate | ChEBI |
| mellitate(6−) | ChEBI |
| mellitic acid(6−) | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Gmelin:338460 | Gmelin |
| Beilstein:3919333 | Beilstein |