EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H6O12 |
| Net Charge | 0 |
| Average Mass | 342.168 |
| Monoisotopic Mass | 341.98593 |
| SMILES | O=C(O)c1c(C(=O)O)c(C(=O)O)c(C(=O)O)c(C(=O)O)c1C(=O)O |
| InChI | InChI=1S/C12H6O12/c13-7(14)1-2(8(15)16)4(10(19)20)6(12(23)24)5(11(21)22)3(1)9(17)18/h(H,13,14)(H,15,16)(H,17,18)(H,19,20)(H,21,22)(H,23,24) |
| InChIKey | YDSWCNNOKPMOTP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mellitic acid (CHEBI:41089) is a hexacarboxylic acid (CHEBI:59359) |
| mellitic acid (CHEBI:41089) is conjugate acid of mellitic acid hexaanion (CHEBI:59227) |
| Incoming Relation(s) |
| mellitic acid hexaanion (CHEBI:59227) is conjugate base of mellitic acid (CHEBI:41089) |
| IUPAC Name |
|---|
| benzene-1,2,3,4,5,6-hexacarboxylic acid |
| Synonyms | Source |
|---|---|
| 1,2,3,4,5,6-Benzenehexacarboxylic acid | ChemIDplus |
| benzene hexacarboxylic acid | ChEBI |
| Benzenehexacarboxylic acid | ChemIDplus |
| Hexacarboxybenzene | ChemIDplus |
| Mellic acid | ChemIDplus |
| Citations |
|---|