EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12ClNO2 |
| Net Charge | 0 |
| Average Mass | 273.719 |
| Monoisotopic Mass | 273.05566 |
| SMILES | C[C@H](C(=O)O)c1ccc2c(c1)nc1ccc(Cl)cc12 |
| InChI | InChI=1S/C15H12ClNO2/c1-8(15(18)19)9-2-4-11-12-7-10(16)3-5-13(12)17-14(11)6-9/h2-8,17H,1H3,(H,18,19)/t8-/m0/s1 |
| InChIKey | PUXBGTOOZJQSKH-QMMMGPOBSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor A compound or agent that combines with cyclooxygenases (EC 1.14.99.1) and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of icosanoids, prostaglandins, and thromboxanes. |
| Applications: | photosensitizing agent A chemical compound that can be excited by light of a specific wavelength and subsequently transfer energy to a chosen reactant. This is commonly molecular oxygen within a cancer tissue, which is converted to (highly rective) singlet state oxygen. This rapidly reacts with any nearby biomolecules, ultimately killing the cancer cells. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-carprofen (CHEBI:59207) is a carprofen (CHEBI:364453) |
| (S)-carprofen (CHEBI:59207) is enantiomer of (R)-carprofen (CHEBI:59206) |
| Incoming Relation(s) |
| (R)-carprofen (CHEBI:59206) is enantiomer of (S)-carprofen (CHEBI:59207) |
| IUPAC Name |
|---|
| (2S)-2-(6-chloro-9H-carbazol-2-yl)propanoic acid |
| Synonyms | Source |
|---|---|
| (+)-carprofen | ChEBI |
| (S)-2-(3-chloro-9H-carbazol-7-yl)propanoic acid | ChEBI |
| (S)-2-(6-chloro-9H-carbazol-2-yl)-propionic acid | ChEBI |
| (S)-6-chloro-α-methylcarbazole-2-acetic acid | ChEBI |
| (S)-(+)-carprofen | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6571973 | Reaxys |