EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H32NO5.CH3O3S |
| Net Charge | 0 |
| Average Mass | 557.665 |
| Monoisotopic Mass | 557.20834 |
| SMILES | CS(=O)(=O)[O-].Cc1ccc(C(=O)Oc2ccc([C@@H](O)C[NH2+]C(C)(C)C)cc2OC(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C28H31NO5.CH4O3S/c1-18-6-10-20(11-7-18)26(31)33-24-15-14-22(23(30)17-29-28(3,4)5)16-25(24)34-27(32)21-12-8-19(2)9-13-21;1-5(2,3)4/h6-16,23,29-30H,17H2,1-5H3;1H3,(H,2,3,4)/t23-;/m0./s1 |
| InChIKey | HODFCFXCOMKRCG-BQAIUKQQSA-N |
| Roles Classification |
|---|
| Biological Role: | beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. |
| Applications: | bronchodilator agent An agent that causes an increase in the expansion of a bronchus or bronchial tubes. beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. anti-asthmatic drug A drug used to treat asthma. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-bitolterol mesylate (CHEBI:59190) is a bitolterol mesylate (CHEBI:3134) |
| (R)-bitolterol mesylate (CHEBI:59190) is enantiomer of (S)-bitolterol mesylate (CHEBI:59191) |
| Incoming Relation(s) |
| (S)-bitolterol mesylate (CHEBI:59191) is enantiomer of (R)-bitolterol mesylate (CHEBI:59190) |
| IUPAC Name |
|---|
| 4-[(1R)-2-(tert-butylamino)-1-hydroxyethyl]benzene-1,2-diyl bis(4-methylbenzoate) methanesulfonate |
| Synonyms | Source |
|---|---|
| 4-[(1R)-2-(tert-butylamino)-1-hydroxyethyl]benzene-1,2-diyl bis(4-methylbenzoate) mesylate | ChEBI |
| N-[(2R)-2-{3,4-bis[(4-methylbenzoyl)oxy]phenyl}-2-hydroxyethyl]-2-methylpropan-2-aminium methanesulfonate | IUPAC |
| (R)-bitolterol mesilat | ChEBI |
| (R)-bitolterol mesilate | ChEBI |
| (R)-bitolterol methanesulfonate salt | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| DB00901 | DrugBank |