EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H32NO5.CH3O3S |
| Net Charge | 0 |
| Average Mass | 557.665 |
| Monoisotopic Mass | 557.20834 |
| SMILES | CS(=O)(=O)[O-].Cc1ccc(C(=O)Oc2ccc(C(O)C[NH2+]C(C)(C)C)cc2OC(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C28H31NO5.CH4O3S/c1-18-6-10-20(11-7-18)26(31)33-24-15-14-22(23(30)17-29-28(3,4)5)16-25(24)34-27(32)21-12-8-19(2)9-13-21;1-5(2,3)4/h6-16,23,29-30H,17H2,1-5H3;1H3,(H,2,3,4) |
| InChIKey | HODFCFXCOMKRCG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. |
| Applications: | bronchodilator agent An agent that causes an increase in the expansion of a bronchus or bronchial tubes. anti-asthmatic drug A drug used to treat asthma. beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bitolterol mesylate (CHEBI:3134) has part bitolterol (CHEBI:3133) |
| bitolterol mesylate (CHEBI:3134) has role anti-asthmatic drug (CHEBI:49167) |
| bitolterol mesylate (CHEBI:3134) has role bronchodilator agent (CHEBI:35523) |
| bitolterol mesylate (CHEBI:3134) has role β-adrenergic agonist (CHEBI:35522) |
| bitolterol mesylate (CHEBI:3134) is a carboxylic ester (CHEBI:33308) |
| bitolterol mesylate (CHEBI:3134) is a diester (CHEBI:51307) |
| bitolterol mesylate (CHEBI:3134) is a methanesulfonate salt (CHEBI:38037) |
| bitolterol mesylate (CHEBI:3134) is a secondary alcohol (CHEBI:35681) |
| Incoming Relation(s) |
| (R)-bitolterol mesylate (CHEBI:59190) is a bitolterol mesylate (CHEBI:3134) |
| (S)-bitolterol mesylate (CHEBI:59191) is a bitolterol mesylate (CHEBI:3134) |
| IUPAC Name |
|---|
| 4-[2-(tert-butylamino)-1-hydroxyethyl]benzene-1,2-diyl bis(4-methylbenzoate) methanesulfonate |
| Synonyms | Source |
|---|---|
| 4-[2-(tert-butylamino)-1-hydroxyethyl]benzene-1,2-diyl bis(4-methylbenzoate) mesylate | ChEBI |
| 4-(2-(tert-butylamino)-1-hydroxyethyl)-o-phenylene di-p-toluate mesylate | ChEBI |
| 4-(2-(tert-butylamino)-1-hydroxyethyl)-o-phenylene di-p-toluate methanesulfonate | ChemIDplus |
| 4-[2-(tert-butylamino)-1-hydroxyethyl]-o-phenylene di-p-toluate mesylate | ChEBI |
| 4-[2-(tert-butylamino)-1-hydroxyethyl]-o-phenylene di-p-toluate methanesulfonate | ChEBI |
| bitolterol mesilat | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4103660 | Beilstein |
| CAS:30392-41-7 | ChemIDplus |