EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H30NO.Cl |
| Net Charge | 0 |
| Average Mass | 347.930 |
| Monoisotopic Mass | 347.20159 |
| SMILES | OC(CC[NH+]1CCCCC1)(c1ccccc1)C1CC2C=CC1C2.[Cl-] |
| InChI | InChI=1S/C21H29NO.ClH/c23-21(19-7-3-1-4-8-19,11-14-22-12-5-2-6-13-22)20-16-17-9-10-18(20)15-17;/h1,3-4,7-10,17-18,20,23H,2,5-6,11-16H2;1H |
| InChIKey | RDNLAULGBSQZMP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. parasympatholytic Any cholinergic antagonist that inhibits the actions of the parasympathetic nervous system. The major group of drugs used therapeutically for this purpose is the muscarinic antagonists. |
| Applications: | antiparkinson drug A drug used in the treatment of Parkinson's disease. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. parasympatholytic Any cholinergic antagonist that inhibits the actions of the parasympathetic nervous system. The major group of drugs used therapeutically for this purpose is the muscarinic antagonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| biperiden hydrochloride (CHEBI:59171) has part biperiden (CHEBI:3112) |
| biperiden hydrochloride (CHEBI:59171) has role antiparkinson drug (CHEBI:48407) |
| biperiden hydrochloride (CHEBI:59171) has role muscarinic antagonist (CHEBI:48876) |
| biperiden hydrochloride (CHEBI:59171) has role parasympatholytic (CHEBI:50370) |
| biperiden hydrochloride (CHEBI:59171) is a hydrochloride (CHEBI:36807) |
| biperiden hydrochloride (CHEBI:59171) is a organic molecular entity (CHEBI:50860) |
| biperiden hydrochloride (CHEBI:59171) is a piperidines (CHEBI:26151) |
| biperiden hydrochloride (CHEBI:59171) is a racemate (CHEBI:60911) |
| biperiden hydrochloride (CHEBI:59171) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| 1-(bicyclo[2.2.1]hept-5-en-2-yl)-1-phenyl-3-(piperidin-1-yl)propan-1-ol hydrochloride |
| Synonyms | Source |
|---|---|
| 1-[3-(bicyclo[2.2.1]hept-5-en-2-yl)-3-hydroxy-3-phenylpropyl]piperidine hydrochloride | ChEBI |
| 1-[3-(bicyclo[2.2.1]hept-5-en-2-yl)-3-hydroxy-3-phenylpropyl]piperidinium chloride | IUPAC |
| 1-bicycloheptenyl-1-phenyl-3-piperidinopropanol-1 hydrochloride | ChemIDplus |
| Akinophyl | ChEMBL |
| biperiden HCl | ChemIDplus |
| Biperideni hydrochloridum | ChEMBL |
| Brand Name | Source |
|---|---|
| Akineton ret | ChEMBL |
| Citations |
|---|