EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:59171 - biperiden hydrochloride
| Formula | C21H30NO.Cl |
| Net Charge | 0 |
| Average Mass | 347.930 |
| Monoisotopic Mass | 347.20159 |
| SMILES | OC(CC[NH+]1CCCCC1)(c1ccccc1)C1CC2C=CC1C2.[Cl-] |
| InChI | InChI=1S/C21H29NO.ClH/c23-21(19-7-3-1-4-8-19,11-14-22-12-5-2-6-13-22)20-16-17-9-10-18(20)15-17;/h1,3-4,7-10,17-18,20,23H,2,5-6,11-16H2;1H |
| InChIKey | RDNLAULGBSQZMP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | parasympatholytic Any cholinergic antagonist that inhibits the actions of the parasympathetic nervous system. The major group of drugs used therapeutically for this purpose is the muscarinic antagonists. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | parasympatholytic Any cholinergic antagonist that inhibits the actions of the parasympathetic nervous system. The major group of drugs used therapeutically for this purpose is the muscarinic antagonists. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. antiparkinson drug A drug used in the treatment of Parkinson's disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| biperiden hydrochloride (CHEBI:59171) has part biperiden (CHEBI:3112) |
| biperiden hydrochloride (CHEBI:59171) has role antiparkinson drug (CHEBI:48407) |
| biperiden hydrochloride (CHEBI:59171) has role muscarinic antagonist (CHEBI:48876) |
| biperiden hydrochloride (CHEBI:59171) has role parasympatholytic (CHEBI:50370) |
| biperiden hydrochloride (CHEBI:59171) is a hydrochloride (CHEBI:36807) |
| biperiden hydrochloride (CHEBI:59171) is a piperidines (CHEBI:26151) |
| biperiden hydrochloride (CHEBI:59171) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| 1-(bicyclo[2.2.1]hept-5-en-2-yl)-1-phenyl-3-(piperidin-1-yl)propan-1-ol hydrochloride |
| Synonyms | Source |
|---|---|
| 1-bicycloheptenyl-1-phenyl-3-piperidinopropanol-1 hydrochloride | ChemIDplus |
| biperiden HCl | ChemIDplus |
| 1-[3-(bicyclo[2.2.1]hept-5-en-2-yl)-3-hydroxy-3-phenylpropyl]piperidine hydrochloride | ChEBI |
| 1-[3-(bicyclo[2.2.1]hept-5-en-2-yl)-3-hydroxy-3-phenylpropyl]piperidinium chloride | IUPAC |