EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H13N3O6.2H2O.2Na |
| Net Charge | 0 |
| Average Mass | 437.316 |
| Monoisotopic Mass | 437.08110 |
| SMILES | O.O.O=C([O-])CCNC(=O)c1ccc(/N=N/c2ccc(O)c(C(=O)[O-])c2)cc1.[Na+].[Na+] |
| InChI | InChI=1S/C17H15N3O6.2Na.2H2O/c21-14-6-5-12(9-13(14)17(25)26)20-19-11-3-1-10(2-4-11)16(24)18-8-7-15(22)23;;;;/h1-6,9,21H,7-8H2,(H,18,24)(H,22,23)(H,25,26);;;2*1H2/q;2*+1;;/p-2/b20-19+;;;; |
| InChIKey | XDCNKOBSQURQOZ-MVIJUDHYSA-L |
| Roles Classification |
|---|
| Applications: | anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. gastrointestinal drug A drug used for its effects on the gastrointestinal system, e.g. controlling gastric acidity, regulating gastrointestinal motility and water flow, and improving digestion. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| balsalazide disodium (CHEBI:59164) has functional parent balsalazide (CHEBI:267413) |
| balsalazide disodium (CHEBI:59164) has part balsalazide(2−) (CHEBI:59165) |
| balsalazide disodium (CHEBI:59164) has role anti-ulcer drug (CHEBI:49201) |
| balsalazide disodium (CHEBI:59164) has role gastrointestinal drug (CHEBI:55324) |
| balsalazide disodium (CHEBI:59164) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| balsalazide disodium (CHEBI:59164) is a hydrate (CHEBI:35505) |
| balsalazide disodium (CHEBI:59164) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| disodium 5-[(E)-{4-[(2-carboxylatoethyl)carbamoyl]phenyl}diazenyl]-2-hydroxybenzoate—water (1/2) |
| Synonyms | Source |
|---|---|
| sodium 5-[(E)-{4-[(2-carboxylatoethyl)carbamoyl]phenyl}diazenyl]-2-hydroxybenzoate hydrate (2:1:2) | IUPAC |
| disodium 5-((4-(((2-carboxyethyl)amino)carbonyl)phenyl)azo)-2-hydroxybenzoate dihydrate | ChEBI |
| disodium balsalazide | KEGG DRUG |
| balsalazide sodium | ChEBI |
| disodium 5-[4-(2-carboxyethylcarbamoyl)phenylazo]salicylate | ChEBI |
| bisalazine disodium | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8245993 | Beilstein |
| CAS:150399-21-6 | ChemIDplus |
| CAS:150399-21-6 | KEGG DRUG |