EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H15N3O6 |
| Net Charge | 0 |
| Average Mass | 357.322 |
| Monoisotopic Mass | 357.09609 |
| SMILES | O=C(O)CCNC(=O)c1ccc(/N=N/c2ccc(O)c(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C17H15N3O6/c21-14-6-5-12(9-13(14)17(25)26)20-19-11-3-1-10(2-4-11)16(24)18-8-7-15(22)23/h1-6,9,21H,7-8H2,(H,18,24)(H,22,23)(H,25,26)/b20-19+ |
| InChIKey | IPOKCKJONYRRHP-FMQUCBEESA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Applications: | non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. gastrointestinal drug A drug used for its effects on the gastrointestinal system, e.g. controlling gastric acidity, regulating gastrointestinal motility and water flow, and improving digestion. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| balsalazide (CHEBI:267413) has role anti-ulcer drug (CHEBI:49201) |
| balsalazide (CHEBI:267413) has role gastrointestinal drug (CHEBI:55324) |
| balsalazide (CHEBI:267413) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| balsalazide (CHEBI:267413) has role prodrug (CHEBI:50266) |
| balsalazide (CHEBI:267413) is a monohydroxybenzoic acid (CHEBI:25389) |
| balsalazide (CHEBI:267413) is conjugate acid of balsalazide(2−) (CHEBI:59165) |
| Incoming Relation(s) |
| balsalazide disodium (CHEBI:59164) has functional parent balsalazide (CHEBI:267413) |
| balsalazide(2−) (CHEBI:59165) is conjugate base of balsalazide (CHEBI:267413) |
| IUPAC Name |
|---|
| 5-[(E)-{4-[(2-carboxyethyl)carbamoyl]phenyl}diazenyl]-2-hydroxybenzoic acid |
| INNs | Source |
|---|---|
| balsalazida | ChemIDplus |
| balsalazide | ChemIDplus |
| balsalazidum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 3-(2-{4-[(2-carboxyethyl)carbamoyl]phenyl}hydrazinylidene)-6-oxocyclohexa-1,4-diene-1-carboxylic acid | IUPAC |
| 5-[4-(2-carboxy-ethylcarbamoyl)-phenylazo]-2-hydroxy-benzoic acid | ChEBI |
| balsalazido | ChemIDplus |
| (E)-5-((4-(((2-carboxyethyl)amino)carbonyl)phenyl)azo)-2-hydroxybenzoic acid | ChemIDplus |
| (E)-5-({p-[(2-carboxyethyl)carbamoyl]phenyl}azo)-2-salicylic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8081576 | Reaxys |
| CAS:80573-04-2 | ChemIDplus |
| Citations |
|---|