EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H5O2S |
| Net Charge | -1 |
| Average Mass | 153.182 |
| Monoisotopic Mass | 153.00157 |
| SMILES | O=C([O-])c1ccccc1S |
| InChI | InChI=1S/C7H6O2S/c8-7(9)5-3-1-2-4-6(5)10/h1-4,10H,(H,8,9)/p-1 |
| InChIKey | NBOMNTLFRHMDEZ-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thiosalicylate(1−) (CHEBI:59127) is a benzoates (CHEBI:22718) |
| thiosalicylate(1−) (CHEBI:59127) is conjugate base of thiosalicylic acid (CHEBI:59124) |
| Incoming Relation(s) |
| thiosalicylic acid (CHEBI:59124) is conjugate acid of thiosalicylate(1−) (CHEBI:59127) |
| IUPAC Name |
|---|
| 2-sulfanylbenzoate |
| Synonyms | Source |
|---|---|
| 2-mercaptobenzoate | ChEBI |
| thiosalicylate | ChEBI |
| thiosalicylic acid anion | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4933280 | Reaxys |
| Gmelin:83032 | Gmelin |